|
benzo[a]azulene |
Molecular Formula: |
C14H10 |
Molecular Weight: |
178.233 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
BMZTYILRNHCUBV-UHFFFAOYAS |
Smiles: |
C1=CC=C2C(=CC3=C2C=CC=C3)C=C1 |
![Chemical structure of benzo[a]azulene](/molimg/1/big/10/10161.gif) |
Synthesis Reference |
|
Journal of the American Chemical Society, 106, p. 3705, 1984 DOI: 10.1021/ja00324a070 |
|
|
Synonym Chemical Name(s) |
|
cyclohepta[a]indene benzo[a]azulen benzo[a]azulène ベンゾ[a]アズレン
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Indenes
|
Here you have an access to the other substances |
|
1-azaspiro[4.5]decane-2,7-dione |
4-ethyl 1,2-dimethyl (1Z)-1-butene-1,2,4-tricarboxylate |
ethyl (2E,4E)-4-methyl-2,4-hexadienoate |
ethyl (3E)-4-methyl-3,5-hexadienoate |
diethyl 2-[(Z)-1,2-dichloroethenyl]-2-ethylmalonate |
diethyl 2-ethyl-2-ethynylmalonate |
methyl 1-(chloroethynyl)cyclohexanecarboxylate |
2,6-dimethyl-6-(phenylethynyl)-2-cyclohexen-1-one |
2-(3-thiophen-2-ylprop-2-ynyl)-1,3-dioxolane |
2-methyl-2-[(1E,3E)-5-methyl-1,3-hexadienyl]-1,3-dioxolane |
1-phenyl-1-heptanol (614-54-0) |
1-bromo-2-methylenecyclopropane |
cyclohepta[b]pyrrole |
diethyl 2-(1,3a,4,5,6,6a-hexahydro-1-pentalenyl)-2-hydroxymalonate |
diethyl 2-[(2E)-4-(2-cyclopenten-1-yl)-2-butenyl]-2-hydroxymalonate |
dimethyl (3Z)-3-dodecenedioate |
diethyl 2-hydroxy-2-(3-methyl-2-butenyl)malonate |
diethyl 2-cinnamyl-2-hydroxypropanedioate |
diethyl 2-(1-cyclohexen-1-ylmethyl)-2-hydroxymalonate |
diethyl-penta-1,2-dien-3-ylborane |
dimethyl (3E,5E)-2-oxo-3,5-heptadienylphosphonate |
ethyl 8-methyl-11-oxobicyclo[4.4.1]undeca-2,4,8-triene-2-carboxylate |
2-chloro-1-(chloromethyl)ethyl benzoate |
2-chloro-1-methylethyl benzoate |
benzyl (3,3-dimethyl-2-methylenecyclohexyl)acetate |
|
|