|
benzylbenzene |
Molecular Formula: |
C13H12 |
Molecular Weight: |
168.238 g/mol |
|
|
Registry Numbers |
Cas Number: 101-81-5 |
EINECS Number: 202-978-6 |
MDL Number: MFCD00004781 |
|
InChIKey: |
CZZYITDELCSZES-UHFFFAOYAV |
Smiles: |
C(C1=CC=CC=C1)C2=CC=CC=C2 |
 |
Synthesis Reference |
|
Chemical and Pharmaceutical Bulletin, 27, p. 2405, 1979 Journal of the American Chemical Society, 91, p. 5663, 1969 DOI: 10.1021/ja01048a053 The Journal of Organic Chemistry, 57, p. 2143, 1992 |
|
|
Synonym Chemical Name(s) |
|
benzyl-benzene phenylmethylbenzene benzylbenzol benzylbenzène ベンジルベンゼン
|
Physical Properties |
Melting Point: 24.5-25 ºC
Boiling Point: 265 ºC |
Density: 1 g/mL
Refractive Index: 1.5770 |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Here you have an access to the other substances |
|
N-(2-hydroxy-3-pyridinyl)urea |
1-[(4-methylphenyl)sulfonyl][1,3]oxazolo[5,4-b]pyridin-2(1H)-one |
2-methyl[1,3]oxazolo[5,4-b]pyridine |
[1,3]oxazolo[5,4-b]pyridin-2-amine |
[1-(3-methoxyphenyl)cyclohexyl]acetyl azide |
[1-(3-methoxyphenyl)cyclohexyl]methanamine |
6-propyl[1,3,4]thiadiazolo[3,2-d]tetraazole |
4-methylpyridine (108-89-4) |
2,3-quinoxalinediamine (6640-47-7) |
2-(4-nitrophenyl)[1,3]oxazolo[4,5-b]quinoxaline |
ethyl 2-methyl-3-quinolinecarboxylate (15785-08-7) |
2,6-dimethyl-4-pyrimidinecarbonitrile |
2-thiophenecarbonitrile (1003-31-2) |
3-amino-1,8-naphthyridine-2-carbonitrile |
2-propyl-1,3-cyclopentanedione |
5-methyl-2-thioxo-hexahydro-pyrimidine-4,6-dione (23450-37-5) |
1-methyl-1,9-dihydro-6H-purin-6-one (1125-39-9) |
2-(3-oxo-1-phenylbutyl)-1H-indene-1,3(2H)-dione |
benzo[g]pteridine-2,4(1H,3H)-dione 5-oxide |
2'-(cyanomethyl)[1,1'-biphenyl]-2-carboxylic acid |
N-ethyl-1H-indole-2-carboxamide |
Benzamide (55-21-0) |
ethyl 1H-indole-2-carboxylate (3770-50-1) |
3-methoxy-9,10-dihydro-2-phenanthrenol |
1-naphthylacetonitrile (132-75-2) |
|
|