diphenyldithioperoxyanhydride |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C14H10O2S2 |
||||
Molecular Weight: |
274.364 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
YYWLHHUMIIIZDH-UHFFFAOYAP |
||||
Smiles: |
O=C(SSC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Organic Syntheses, Coll. Vol. 3, p. 116, 1955 |
|||||
Synonym Chemical Name(s) | |||||
|
S-benzoylsulfanyl benzenecarbothioate |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Here you have an access to the other substances | |||||
|
2-amino-2-phenylpropanenitrile | 2-phenylalanine (6945-32-0) | N-hydroxy-3-phenyl-beta-alanine (6320-08-7) | 3-aminopropanenitrile (151-18-8) | 3,3'-Iminodipropionitrile (111-94-4) | 1H-1,2,4-triazol-3-amine (61-82-5) | formic hydrazide (624-84-0) | 4H-1,2,4-triazol-4-amine (584-13-4) | (E)-1-(2-aminophenyl)-2-hydroxydiazene | 1H-1,2,3-benzotriazole (95-14-7) | (2E)-4-oxo-4-phenyl-2-butenoic acid (583-06-2) | benzoyl cyanide (613-90-1) | 1-diazo-3-phenylacetone | 1-chloro-3-phenylacetone (937-38-2) | 1,5-hexadiene (592-42-7) | 1,2-dibromoethyl acetate (24442-57-7) | 2-bromo-1,1-diethoxyethane (2032-35-1) | (3Z)-3-bromo-4-phenyl-3-buten-2-one | 2-bromo-1,1-dimethoxyheptane | 2-bromoheptanal | 2-bromo-4-methylphenol (6627-55-0) | 6-bromo-2-naphthol (15231-91-1) | 9-bromophenanthrene (573-17-1) | 2-bromopyridine (109-04-6) | 4-bromo-1,2-dimethylbenzene (583-71-1) | |
|||||
