ethyl 3-cyano-2-oxo-3-phenylpropanoate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C12H11NO3 |
||||
Molecular Weight: |
217.224 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
YWNRATDDUSMBPR-UHFFFAOYAD |
||||
Smiles: |
CCOC(=O)C(=O)C(C#N)C1=CC=CC=C1 |
||||
 |
|||||
Synthesis Reference | |||||
|
Organic Syntheses, Coll. Vol. 2, p. 287, 1943 |
|||||
Synonym Chemical Name(s) | |||||
|
3-cyano-2-oxo-3-phenyl-propionic acid ethyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
ethoxyacetic acid (627-03-2) | Ethyl ethoxyacetate (817-95-8) | diethyl 2-acetylsuccinate (1115-30-6) | diethyl hexanedioate (141-28-6) | ethyl 2-benzoyl-3-oxobutanoate (569-37-9) | diethyl 2-methyl-3-oxosuccinate (759-65-9) | 10-ethoxy-10-oxodecanoic acid (693-55-0) | ethyl methylcarbamate (105-40-8) | diethyl 2-methylmalonate (609-08-5) | ethyl 1-naphthoate (3007-97-4) | ethyl 3-oxo-2-phenylbutanimidoate | ethyl 3-oxo-2-phenylbutanoate (5413-05-8) | diethyl 2-oxo-3-phenylsuccinate (7147-33-3) | 1-ethyl-1-(3-methylphenyl)-2-oxohydrazine | N-ethyl-3-methylaniline (102-27-2) | Tridecanenitrile (629-60-7) | Tridecanoic acid (638-53-9) | ethyl tridecanoate (28267-29-0) | ethyl 4-fluorobenzoate (451-46-7) | 4-fluorobenzoic acid (456-22-4) | 1-(2,3,4-trihydroxyphenyl)ethanone (528-21-2) | Glyceraldehyde (497-09-6) | 3,3-diethoxy-1,2-propanediol (10487-05-5) | 1,3-dibromo-2-propanol (96-21-9) | ethyl aminoacetate (459-73-4) | |
|||||
