2-octan-2-yloxycarbonylbenzoic acid |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C16H22O4 |
||||
Molecular Weight: |
278.348 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
DUJBEEUYBSLMGM-HCKMINDGCT |
||||
Smiles: |
CCCCCCC(C)OC(=O)C1=C(C=CC=C1)C(O)=O |
||||
 |
|||||
Synthesis Reference | |||||
|
Organic Syntheses, Coll. Vol. 1, p. 418, 1941 |
|||||
Synonym Chemical Name(s) | |||||
|
2-(1-methylheptoxycarbonyl)benzoic acid |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
1-(amino-phenylmethyl)naphthalen-2-ol (481-82-3) | Nicotinic Acid (59-67-6) | 10-nitro-10H-anthracen-9-one (6313-44-6) | 3-nitrobenzoic acid (121-92-6) | 4-nitrobenzoyl chloride (122-04-3) | (4-nitrophenyl)acetonitrile (555-21-5) | nitromethane (75-52-5) | 3-nitrophenol (554-84-7) | 4-nitro-2-benzofuran-1,3-dione (641-70-3) | 1-Phenyl-2-nitroethene (102-96-5) | 1-methyl-3-nitrobenzene (99-08-1) | nitro-urea (556-89-8) | Oxalic acid (144-62-7) | pentaerythritol (115-77-5) | (2E)-2-pentene (109-68-2) | 3-bromo-propoxy-benzene (588-63-6) | 1-phenylhydrazine (100-63-0) | isothiocyanatobenzene (103-72-0) | N-phenylhydrazinecarboxamide (537-47-3) | ethyl (2E)-2-cyano-3-phenyl-2-propenoate (2025-40-3) | ethyl 2,3-dicyano-3-phenylpropanoate (5473-13-2) | N-phenylurea (64-10-8) | 2,4,6-triaminobenzoic acid | 1,3,5-benzenetriol (108-73-6) | 1H-Pyrrole (109-97-7) | |
|||||
