methyl 3-methoxy-5,6,7,8-tetrahydro-2-naphthalenecarboxylate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C13H16O3 |
||||
Molecular Weight: |
220.268 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
GIPIDPLEUNBMMG-UHFFFAOYAV |
||||
Smiles: |
COC(=O)C1=CC2=C(CCCC2)C=C1OC |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Organic Syntheses, Coll. Vol. 8, p. 444, 1993 |
|||||
Synonym Chemical Name(s) | |||||
|
3-methoxy-5,6,7,8-tetrahydro-naphthalene-2-carboxylic acid methyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Here you have an access to the other substances | |||||
|
pentanedinitrile (544-13-8) | 3,4,5-trimethoxybenzoic acid (118-41-2) | 1,3,5-trinitrobenzene (99-35-4) | 2,4,6-trinitrobenzoic acid (129-66-8) | 9H-xanthen-9-one (90-47-1) | 9H-xanthen-9-ol (90-46-0) | 3-butyl-2-cyclobuten-1-one | 2,4-dichloro-1-methoxybenzene (553-82-2) | ethyl 3,3-diethoxypropanoate (10601-80-6) | 3-hexylcyclobutanone | 1-methylolcyclohexan-1-ol (15753-47-6) | 5H-furan-2-one (497-23-4) | 2-(bromomethyl)-1H-isoindole-1,3(2H)-dione (5332-26-3) | (1-methyl-3-oxocyclohexyl)acetic acid | 4-nitro-1H-indole (4769-97-5) | 1,2,3,4,5-pentamethyl-1,3-cyclopentadiene (4045-44-7) | triethyl 2,3,6-pyridinetricarboxylate | 1,4-dithian-2-one | 3-chloro-1,4-dithian-2-one | 3-bromo-5,6-dihydro-2H-pyran-2-one (104184-64-7) | 3-bromo-2H-pyran-2-one (19978-32-6) | tert-butyl 1-indolinecarboxylate (143262-10-6) | tert-butyl 7-formyl-1-indolinecarboxylate (174539-67-4) | 7-indolinecarbaldehyde (143262-21-9) | 1-ethynyl-4-methoxybenzene (768-60-5) | |
|||||
