|
4-nitro-1H-indole |
Molecular Formula: |
C8H6N2O2 |
Molecular Weight: |
162.148 g/mol |
|
|
Registry Numbers |
Cas Number: 4769-97-5 |
EINECS Number: n/a |
MDL Number: MFCD00010056 |
|
InChIKey: |
LAVZKLJDKGRZJG-UHFFFAOYAI |
Smiles: |
[O-][N+](=O)C1=CC=CC2=C1C=C[NH]2 |
 |
Synthesis Reference |
|
Organic Syntheses, Coll. Vol. 8, p. 493, 1993
|
|
|
Synonym Chemical Name(s) |
|
4-nitro-1H-indole
4-ニトロ-1H-インドール
|
Physical Properties |
Melting Point: 203-207 ºC
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Indoles
Nitro Compounds
|
Here you have an access to the other substances |
|
2,4,6-trinitrobenzoic acid (129-66-8) |
9H-xanthen-9-one (90-47-1) |
9H-xanthen-9-ol (90-46-0) |
3-butyl-2-cyclobuten-1-one |
2,4-dichloro-1-methoxybenzene (553-82-2) |
ethyl 3,3-diethoxypropanoate (10601-80-6) |
3-hexylcyclobutanone |
1-methylolcyclohexan-1-ol (15753-47-6) |
5H-furan-2-one (497-23-4) |
methyl 3-methoxy-5,6,7,8-tetrahydro-2-naphthalenecarboxylate |
2-(bromomethyl)-1H-isoindole-1,3(2H)-dione (5332-26-3) |
(1-methyl-3-oxocyclohexyl)acetic acid |
1,2,3,4,5-pentamethyl-1,3-cyclopentadiene (4045-44-7) |
triethyl 2,3,6-pyridinetricarboxylate |
1,4-dithian-2-one |
3-chloro-1,4-dithian-2-one |
3-bromo-5,6-dihydro-2H-pyran-2-one (104184-64-7) |
3-bromo-2H-pyran-2-one (19978-32-6) |
tert-butyl 1-indolinecarboxylate (143262-10-6) |
tert-butyl 7-formyl-1-indolinecarboxylate (174539-67-4) |
7-indolinecarbaldehyde (143262-21-9) |
1-ethynyl-4-methoxybenzene (768-60-5) |
1,2-Benzenedimethanol (612-14-6) |
dimethyl 2-oxomalonate |
1-Boc-Pyrrolidine (86953-79-9) |
|
|