|
2-tert-butyl-1H-indole |
Molecular Formula: |
C12H15N |
Molecular Weight: |
173.258 g/mol |
|
|
Registry Numbers |
Cas Number: 1805-65-8 |
EINECS Number: n/a |
MDL Number: MFCD04004060 |
|
InChIKey: |
WVPGIDWFLXGCLA-UHFFFAOYAQ |
Smiles: |
CC(C)(C)C1=CC2=C([NH]1)C=CC=C2 |
 |
Synthesis Reference |
|
The Journal of Organic Chemistry, 44, p. 1133, 1979 DOI: 10.1021/jo01321a023
Tetrahedron Letters, 29, p. 1799, 1988 DOI: 10.1016/S0040-4039(00)82047-X
|
|
|
Synonym Chemical Name(s) |
|
2-tert-butyl-1H-indole
2-tert-ブチル-1H-インドール
|
Physical Properties |
Melting Point: 75-76 ºC
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Indoles
|
Here you have an access to the other substances |
|
10-thioxo-anthracen-9-one (68629-85-6) |
2,2-dinitro-vinyl-phenyl-amine |
4-bromo-1-indanone (15115-60-3) |
N-(2-hydroxyethyl)acetamide (142-26-7) |
2-acetamidoethyl acetate (16180-96-4) |
1-nitrohexane (646-14-0) |
2,2-dimethyl-2H-chromen-7-yl methyl ether (17598-02-6) |
N-(2,4,5,6,7,7a-hexahydro-1-benzothien-3-yl)acetamide |
4-[(2E)-1,5-dimethyl-2,5-hexadienyl]morpholine |
4-isopropyl-1-methyl-1-cyclohexene (5502-88-5) |
3-phenyl-4,5,6,7-tetrahydro-3H-isobenzofuran-1-one |
N-(3-methoxy-2-methylsulfanylphenyl)-2,2-dimethylpropanamide |
2,6-dimethyl-2,5-heptadiene |
5,12-dihydronaphthacene (959-02-4) |
methyl 2-oxo-2-(4-phenylmethoxyphenyl)acetate |
2-chlorobenzoic acid (118-91-2) |
5-iodopentanoic acid |
4-(3,3-dimethyl-2-oxiranyl)-2-butanone |
2-cyclohexylsulfanyl-isoindole-1,3-dione (17796-82-6) |
4-acetylbenzonitrile (1443-80-7) |
3-thiophenecarbonitrile (1641-09-4) |
2-amino-N'-hydroxy-3-pyridinecarboximidamide |
3-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinamine |
3-oxidopyrido[2,3-d]pyrimidin-4-ylamine |
3-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinylformamide |
|
|