|
5-phenyl-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one |
Molecular Formula: |
C21H16O |
Molecular Weight: |
284.357 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
XKSXBNAYLDOGTC-UHFFFAOYAK |
Smiles: |
O=C1CC2=C(C=CC=C2)C(C3=CC=CC=C3)C4=CC=CC=C14 |
![Chemical structure of 5-phenyl-5,11-dihydro-10H-dibenzo[a,d]cyclohepten-10-one](/molimg/1/big/18/18759.gif) |
Synthesis Reference |
|
The Journal of Organic Chemistry, 26, p. 97, 1961 DOI: 10.1021/jo01060a023 |
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Here you have an access to the other substances |
|
4-hydroperoxy-4-methoxybutyl formate |
4-oxobutyl formate |
S-allyl O-(4-methylphenyl) thiocarbonate |
N-dodecylbenzamide (33140-65-7) |
4-nitro-2-(trifluoromethyl)phenol (1548-61-4) |
2-(10-oxo-9(10H)-anthracenylidene)malononitrile (10395-02-5) |
1,1,1,4,4,5,5,5-octafluoro-2-pentyne |
ethyl (2Z)-3-cyano-2-propenoate (40594-97-6) |
ethyl 2-cyanobenzoate (6525-45-7) |
(5E)-5-(phenylimino)-2(5H)-furanone (19990-26-2) |
phenyl 1H-indene-1-carboxylate |
2-pyridin-2-yl-ethanesulfonic acid (68922-18-9) |
4,5'-Dimethyl angelicin (4063-41-6) |
3-chloro-9-acridinecarbonitrile |
1-tosylazetidine (7730-45-2) |
N,3-dicyclohexyl-2,2-dimethylpropanamide |
2-ethyl-3-methylbutanamide (64037-70-3) |
3-oxobutanoyl fluoride |
isopropyl 3-oxobutanoate (542-08-5) |
3-oxo-N-propylbutanamide |
3-(2-oxo-2,3-dihydro-1H-indol-3-yl)propanoic acid |
2,8-dimethyl-10H-phenoxaphosphin-10-ol 10-oxide (15320-91-9) |
2-(4-bromobutyl)-4-methylphenol |
7-methyl-2,3,4,5-tetrahydro-1-benzoxepine |
4-bromo-N'-isopropylbenzohydrazide |
|
|