|
3-methoxyphenanthro[4,5-bcd]furan |
Molecular Formula: |
C15H10O2 |
Molecular Weight: |
222.243 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
TYLIRYHGHWUWTN-UHFFFAOYAI |
Smiles: |
COC1=C2OC3=C4C(=CC=C3)C=CC(=C24)C=C1 |
![Chemical structure of 3-methoxyphenanthro[4,5-bcd]furan](/molimg/1/big/19/19374.gif) |
Synthesis Reference |
|
The Journal of Organic Chemistry, 20, p. 953, 1955 DOI: 10.1021/jo01125a020
|
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Benzofurans Naphthalenes Dibenzofurans
|
Here you have an access to the other substances |
|
4-methyl-2,2-diphenyl-3,5-thiomorpholinedione |
N-hexyl-2-isonicotinoylhydrazinecarboxamide |
Isoniazid (54-85-3) |
N''-isonicotinoylcarbonohydrazide |
N-ethyl-N'-isonicotinoylurea |
2,4-dinitro-1-sulfosulfanylbenzene |
3-nitrobenzenesulfenyl chloride |
N,N-diethyl-S-(3-nitrophenyl)thiohydroxylamine (61076-30-0) |
(E)-(2-hydroxy-4,5-dimethylphenyl)(phenyl)methanone O-acetyloxime |
5,6-dimethyl-2-phenyl-1,3-benzoxazole |
(E)-(2-hydroxy-5-methylphenyl)(phenyl)methanone oxime |
2-anilino-3-nitrobenzonitrile |
N,N-dimethyl(2-methylphenyl)phenylmethanamine (5350-55-0) |
2,3-dimethyl-1-butanesulfonyl chloride |
6-(3-methoxyphenyl)-3-cyclohexen-1-one |
2-(3-methoxyphenyl)cyclohexanone (15547-89-4) |
3-(2-methoxy-1-naphthyl)propanoic acid |
diethyl 2-hydroxy-4,5-pyrimidinedicarboxylate (62328-19-2) |
1-ethynyl-1-methyl-2-propenyl phenyl carbonate |
1-ethynyl-1-methyl-2-propenyl carbamate |
pyrrolo[1,2-a]quinoline |
3-(trifluoromethyl)-10H-phenothiazine (397-50-2) |
ethyl (3Z)-4-ethyl-2-methyl-3-octenoate |
N-ethyl-4-methoxyaniline |
1-(4-chlorophenyl)ethanamine (6299-02-1) |
|
|