|
methyl 2-(2-methoxy-2-oxoethyl)-5-oxo-1-cyclopentene-1-carboxylate |
Molecular Formula: |
C10H12O5 |
Molecular Weight: |
212.202 g/mol |
|
Cas Number: |
n/a |
InChIKey: |
NXZABCWJMZJLQB-UHFFFAOYAO |
Smiles: |
COC(=O)CC1=C(C(=O)CC1)C(=O)OC |
 |
Synthesis Reference |
|
Canadian Journal of Chemistry, 61, p. 688, 1983 |
|
|
Synonym Name(s) |
|
methyl 2-(2-methoxy-2-oxoethyl)-5-oxocyclopentene-1-carboxylate 5-keto-2-(2-keto-2-methoxy-ethyl)cyclopentene-1-carboxylic acid methyl ester 2-(methoxycarbonyl-methyl)-5-oxo-cyclopentene-1-carboxylic acid methyl ester |
Properties |
Melting Point: n/a |
Boiling Point: n/a |
Density: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
Associated Data Sources |
|
ChemSpider ID: 9228121
PubChem Compound ID: 11052960
|
Here you have an access to the other substances |
|
methyl 5-hydroxy-3-oxo-5-phenylpentanoate
6,6-dimethyl-tetrahydro-pyran-2,4-dione
methyl 6-chloro-5-methoxy-3-oxohexanoate
Methyl Salicylate
dimethyl 3,6-dioxooctanedioate
3,3,12-trimethyl-2,4,11,13-tetraoxapentadec-6-yn-9-ol
1-[(1-ethoxyethoxy)methyl]-5-hydroxy-3-pentynyl acetate
methyl (5Z,8Z)-11-(acetyloxy)-12-hydroxy-5,8-dodecadienoate
methyl (5Z,8Z)-11-(acetyloxy)-12-oxo-5,8-dodecadienoate
9,10-dihydrophenanthrene
|
|