(E)-4,4-dicyano-4-(o-anisylideneamino)but-2-enoic acid methyl ester |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C15H13N3O3 |
||||
Molecular Weight: |
283.287 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
RQEGKFPDFLGZIF-OQUKJUSVBU |
||||
Smiles: |
COC(=O)\C=C\C(N=CC1=CC=CC=C1OC)(C#N)C#N |
||||
![]() |
|||||
Synthesis Reference | |||||
|
The Journal of Organic Chemistry, 58, p. 6474, 1993 DOI: 10.1021/jo00075a053 |
|||||
Synonym Chemical Name(s) | |||||
|
(E)-4,4-dicyano-4-[(2-methoxyphenyl)-methyleneamino]-but-2-enoic acid methyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
methyl 2-ethylnicotinate | N-[(3E)-3-octenyl]benzamide | 1-phenyl-3-pyridin-2-ylpropan-1-ol | 4-phenethyl-hepta-1,6-dien-4-ol | N,N-diisopropyloctanamide (57303-34-1) | 1-methyl-3-phenyl-2-naphthol | 2-p-anisoylmalononitrile | 2-heptyloxirane | 2-(2-methyl-2-oxiranyl)ethanol | Propyl butyrate (105-66-8) | ethyl 2-but-1-enylidene-3-hydroxynonanoate | ethyl 3-hydroxy-2-prop-1-ynylnonanoate | 2-[[4-(dimethylamino)benzyl](methyl)amino]ethanol | 3-(1-benzyl-2-phenylethoxy)-1-propanol | 5-tert-butyl-3-ethyl-4-methylsulfanyl-5H-furan-2-one | 4-methylsulfanyl-3,5-diphenyl-5H-furan-2-one | ethyl (2E)-2-ethyl-3-(methylsulfanyl)-2,5-hexadienoate | methyl 1-formylcyclohexanecarboxylate | N,N-diphenylamine (122-39-4) | 2-(4-hydroxybutyl)cyclopentanone | 2-(3-chloropropyl)-2-phenylcyclopentanone | 1-benzylsulfanyl-3-chloropropan-2-ol | 2-(benzylsulfanyl-methyl)-oxirane | methyl 2-hydroxy-2-phenyl-4-pentenoate | 4-phenyl-1,7-octadiene-4,5-diol | |
|||||
