(E)-5-methyl-3-(4-methylphenyl)sulfonylhex-2-ene-1,4-diol |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C14H20O4S |
||||
Molecular Weight: |
284.376 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
NJFKHTDQHGWEKU-MDWZMJQEBG |
||||
Smiles: |
CC(C)C(O)C(=C/CO)\[S](=O)(=O)C1=CC=C(C)C=C1 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
The Journal of Organic Chemistry, 54, p. 1491, 1989 DOI: 10.1021/jo00268a004 |
|||||
Synonym Chemical Name(s) | |||||
|
(2E)-5-methyl-3-[(4-methylphenyl)sulfonyl]-2-hexene-1,4-diol |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
2-phenyl-1,3-propanediol (1570-95-2) | methyl laurate (111-82-0) | methyl nonanoate (1731-84-6) | 5-(4-methyl-3-pentenyl)-2,3-dihydrofuran | 1-(2-aminophenyl)-1-heptanone | 1-ethylsulfanyl-ethyl-benzene | 2-methyl-1-(3-nitrophenyl)-2-propanol | 2-chloro-1,1,1,3,3,3-hexafluoropropane (431-87-8) | 2-chloro-1,1,1-trifluoropropane | chlorocyclopentane (930-28-9) | bromocyclopentane (137-43-9) | (E)-3-(p-tolylsulfonyl)-prop-2-en-1-ol | 1-(1-ethoxyvinyl)-1-cyclohexene | 2-butoxy-4-ethyl-1,3-hexadiene | 1-(6-methoxy-3,4-dihydro-1-naphthalenyl)ethanone | 2-phenyl-benzaldehyde (1203-68-5) | 2-vinylbenzaldehyde (28272-96-0) | N-tert-butyl-1-methoxy-1-phenylmethanimine oxide | 1-anilino-N-tert-butyl-1-phenylmethanimine oxide | benzoic acid (tert-butylamino) ester | methyl 4-(4-methoxyphenyl)-3-methyl-4-oxobutanoate | (1E)-1-(2-methylenecyclopentylidene)-2-propanol | methyl 2-nonynoate (111-80-8) | methyl (4E)-4-heptenoate | methyl (2E)-2-nonenoate (111-79-5) | |
|||||
