|
Aaptamine |
Molecular Formula: |
C13H12N2O2 |
Molecular Weight: |
228.251 g/mol |
|
|
Registry Numbers |
Cas Number: 85547-22-4 |
EINECS Number: n/a |
MDL Number: MFCD01662128 |
|
InChIKey: |
IVXSXOFPZFVZTM-UHFFFAOYAF |
Smiles: |
COC1=CC2=C3C(=C1OC)NC=CC3=NC=C2 |
 |
Synthesis Reference |
|
The Journal of Organic Chemistry, 52, p. 616, 1987 DOI: 10.1021/jo00380a024
Tetrahedron Letters, 31, p. 569, 1990
|
|
|
Synonym Chemical Name(s) |
|
8,9-dimethoxy-1H-benzo[de][1,6]naphthyridine
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Isoquinolines
|
Here you have an access to the other substances |
|
1,4-divinylbenzene (105-06-6) |
(7-methoxy-1,2,3,4-tetrahydro-1-naphthalenyl)methanol |
2-allyl-5-isopropenyl-2-methylcyclohexanone |
4-phenyl-buta-1,3-diynyl-benzene (886-66-8) |
2-morpholin-4-yl-ethanol (622-40-2) |
4-(2-morpholin-4-yl-ethyl)-morpholine (1723-94-0) |
octadecane (593-45-3) |
2,3-dimethyl-1,4-oxathiane |
5-methyl-5H-dibenzo[c,e]azepine |
methyl 3-acetyloxy-2-hydroxy-6-methylpiperidine-1-carboxylate |
ethyl 2-hydroxy-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylate |
1,2,3,3a,7,8-hexahydrocyclopenta[c]pentalen-4(6H)-one |
8-methoxy-9H-benzo[de][1,6]naphthyridin-9-one |
1-bromo-3-chlorobenzene (108-37-2) |
N,N-diethyl-2-hydroxy-3,4,6-trimethoxybenzamide |
2-phenyl-2-propen-1-amine |
2-butyl-2-propen-1-amine |
neopentyl thiocyanate |
(2,4-ditert-butyl-5-oxo-2,5-dihydro-2-furanyl)acetic acid |
2-methyl-3-nitro-1-propene (1606-31-1) |
dimethyl 2,2-dimethyl-4-methylenepentanedioate |
methyl (2Z)-4,6-dimethyl-5-oxo-3-(1-pyrrolidinyl)-2-heptenoate |
4-fluoro-3-hydroxy-3H-isobenzofuran-1-one |
7-fluoro-3-oxo-1,3-dihydro-2-benzofuran-1-carbonitrile |
(4-methylphenyl)(diphenyl)phosphine (1031-93-2) |
|
|