|
2-tert-butylbenzoic acid |
Molecular Formula: |
C11H14O2 |
Molecular Weight: |
178.231 g/mol |
|
|
Registry Numbers |
Cas Number: 1077-58-3 |
EINECS Number: n/a |
MDL Number: MFCD09258829 |
|
InChIKey: |
ZDFKSZDMHJHQHS-XWKXFZRBCY |
Smiles: |
CC(C)(C)C1=C(C=CC=C1)C(O)=O |
 |
Synthesis Reference |
|
Synthetic Communications, 22, p. 13, 1992 DOI: 10.1080/00397919208021074
|
|
|
Synonym Chemical Name(s) |
|
2-tert-butyl-benzoic acid
2-tert-butylbenzoesäure
acide 2-tert-butylbenzoic
2-tert-ブチル安息香酸
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Carboxylic acids
|
Here you have an access to the other substances |
|
2-chloro-3-(dichloromethyl)-7-methoxyquinoline |
methyl 4-methyl-6-oxo-1-phenyl-1,6-dihydro-3-pyridazinecarboxylate |
6-acetyl-5-methyl-2-phenylpyridazin-3-one (75872-28-5) |
5-methyl-2-phenylpyridazin-3-one |
3-benzyl-1H-pyrimidine-2,4-dione |
3-benzyl-6-butyl-5-methyl-1H-pyrimidine-2,4-dione |
3-benzyl-6-butyl-5-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
2,2-dihydroxy-5-methoxyindene-1,3-dione (106507-42-0) |
2-benzyl-1H-perimidine |
2-(4-methylphenyl)-1H-perimidine |
2-(2-phenoxyethoxy)tetrahydro-2H-pyran |
2-phenoxytetrahydro-2H-pyran (157735-42-7) |
2,6-dimethoxybenzoic acid (1466-76-8) |
N-acetylalanine (1115-69-1) |
1-methyl-2-(trifluoromethyl)-4(1H)-quinolinone |
2,4,4-trimethyl-4H-3,1-benzoxazine |
4-allyl-2-ethyl-4-phenyl-4H-3,1-benzoxazine |
3-methyl-2,3-dihydro-1-benzofuran |
methyl 2-fluorobenzoate (394-35-4) |
1,3-dimethyl-1H-indol-5-yl methyl ether |
methyl 3-bromo-2-propynoate (23680-40-2) |
acrylic acid 2-thiocyanato-ethyl ester |
2-methyl-acrylic acid 10-thiocyanato-decyl ester |
3-hydroxybutyl nitrate |
1-(1-cyclohex-3-enyl-methoxy)-ethoxy-methyl-benzene |
|
|