|
dibenzo[d,f]oxonine-5,8(6H,9H)-dione |
Molecular Formula: |
C16H12O3 |
Molecular Weight: |
252.269 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
QTOVVSQGYXAYOH-UHFFFAOYAI |
Smiles: |
O=C1CC2=C(C=CC=C2)C3=C(C=CC=C3)C(=O)CO1 |
![Chemical structure of dibenzo[d,f]oxonine-5,8(6H,9H)-dione](/molimg/1/big/24/24738.gif) |
Synthesis Reference |
|
Synthetic Communications, 20, p. 137, 1990 DOI: 10.1080/00397919008054625 |
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Here you have an access to the other substances |
|
3-ethyl-2-methyl-3H-[1,2,4]triazino[1,6-b]isoquinoline-4,10-dione |
3-iodo-1-propene (556-56-9) |
1-iodo-3-methyl-2-butene |
2-amino-5-chlorobenzonitrile (5922-60-1) |
2-methylamino-thiobenzoic acid S-methyl ester |
2-hydroxy-5-methoxybenzonitrile (39835-11-5) |
S-methyl 5-chloro-2-hydroxybenzenecarbothioate |
methyl 2-hydroxybenzenecarbimidothioate |
2,3,3-trifluoroacrylic acid (433-68-1) |
ethyl 1-benzofuran-5-carboxylate |
1-(5-pentyl-2-furyl)-3-hexanone |
(2'-glycoloyl[1,1'-biphenyl]-2-yl)acetic acid |
phenanthro[9,10-c]furan-1(3H)-one |
ethyl (2-methyl-1,3-dithiolan-2-yl)acetate |
N-[(1E)-1,3-butadienyl]-N-isopropyl-4-pentenamide |
3-methoxythiophene (17573-92-1) |
N,1-diphenyl-1H-tetraazol-5-amine (64287-36-1) |
N''-hydroxy-N,N'-diphenylguanidine |
1-butyl-2,5-dihydro-1H-pyrrole |
dimethyl methylphosphonate (756-79-6) |
hexanedinitrile (111-69-3) |
Ethyl 2-ethylacetoacetate (607-97-6) |
N-benzyl-4-hydroxy-4-phenylbutanethioamide |
1-ethoxy-2-methoxy-4-[(1E)-1-propenyl]benzene (7784-67-0) |
2-methyl-2-prop-2-enylperoxypropane |
|
|