|
(7Z)-4-nitro-7-decenal |
Molecular Formula: |
C10H17NO3 |
Molecular Weight: |
199.25 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
HOSBTOIIMQOQSM-ARJAWSKDBU |
Smiles: |
CC\C=C/CCC(CCC=O)[N+]([O-])=O |
 |
Synthesis Reference |
|
Synthetic Communications, 19, p. 575, 1989 DOI: 10.1080/00397918908050702
|
|
|
Synonym Chemical Name(s) |
|
(Z)-4-nitro-dec-7-enal
(Z)-4-nitrodec-7-enal
(Z)-4-ニトロデク-7-エナル
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Aldehydes
Nitro Compounds
|
Here you have an access to the other substances |
|
(2E)-2-(4-methoxyphenyl)imino-1-phenylethanone |
6-methyl-3-(4-methylphenyl)-1,2-benzisothiazole 1,1-dioxide |
2-phenyl-1,3-dithiolane (5616-55-7) |
2-methylsulfanyl-1-phenylethanone (5398-93-6) |
1-methylsulfanyl-butan-2-one (13678-58-5) |
phenyl[1-(phenylsulfinyl)cyclopropyl]methanol |
6-nitro-5-quinoxalinamine |
7-bromo-6-nitro-5-quinoxalinamine |
2-(2-chlorophenyl)-1-(3-chlorophenyl)-2-hydroxyethanone |
O-ethyl S-methyl dithiocarbonate (623-54-1) |
5-bromo-2-hydroxynicotinic acid (104612-36-4) |
5-chloro-2-hydroxynicotinic acid (38076-80-1) |
2,5,8-trimethyl-1-benzoxepin-3-one |
2-(hydroxy-phenylmethyl)-4-methylmorpholin-3-one |
4-(4-methoxyphenyl)-3-phenyl-2(5H)-furanone |
tert-butyl 1-methyl-2-oxopropylcarbamate |
(Z)-2-phenylmethoxycarbonylamino-but-2-enoic acid methyl ester (70396-37-1) |
1-methoxy-4-(3-methyl-but-2-enoxy)-benzene |
ethyl 5-methyl-1H-pyrrole-2-carboxylate (3284-51-3) |
5-(4-methoxyphenyl)-2-methyl-2,4,6-cycloheptatrien-1-one |
5-(2-furyl)-2-methoxy-2,4,6-cycloheptatrien-1-one |
5-chloro-2-methoxybenzaldehyde (7035-09-8) |
5-methyltetrahydro-2H-pyran-2-one |
2-chloropyridine (109-09-1) |
1-allyloxyethoxyethane |
|
|