|
1H-benzo[4,5]cyclohepta[1,2-c]furan-1,3,4-trione |
Molecular Formula: |
C13H6O4 |
Molecular Weight: |
226.188 g/mol |
|
Cas Number: |
n/a |
InChIKey: |
KEZVWSNAKYUCER-UHFFFAOYAB |
Smiles: |
O=C1OC(=O)C2=C1C=CC3=C(C=CC=C3)C2=O |
![1H-benzo[4,5]cyclohepta[1,2-c]furan-1,3,4-trione](/molimg/1/big/0/268.gif) |
Synthesis Reference |
|
Canadian Journal of Chemistry, 48, p. 1633, 1970
|
|
|
Properties |
Melting Point: n/a |
Boiling Point: n/a |
Density: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
Associated Data Sources |
|
ChemSpider ID: 21403456
PubChem Compound ID: 24971531
|
Here you have an access to the other substances |
|
1H-inden-3-yl methyl ether
9-methoxy-5H-benzo[a]cycloheptene-7,8-dicarboxylic acid
5-oxo-6,9-dihydro-5H-benzo[a]cycloheptene-7-carboxylic acid
dimethyl 9-hydroxy-5H-benzo[a]cycloheptene-7,8-dicarboxylate
dimethyl 5-oxo-5H-benzo[a]cycloheptene-6,7-dicarboxylate
ethyl 3-(3-ethoxy-3-oxopropyl)-4,5-dimethyl-1H-pyrrole-2-carboxylate
naphtho[1,2-d][1,3]oxazol-2-yl(phenyl)methanone
2-(3,4,4-trimethyl-2-cyclohexen-1-ylidene)malononitrile
ethyl 2-hydroxy-2-methyl-3-phenylpropanimidothioate
S-ethyl 2-hydroxy-2-methyl-3-phenylpropanethioate
|
|