3-imino-3-(4-methylphenyl)-2-thioformylpropanenitrile |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C11H10N2S |
||||
Molecular Weight: |
202.28 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
NGDYPRSREUNVJK-ACCUITESBZ |
||||
Smiles: |
CC1=CC=C(C=C1)C(=N)C(C=S)C#N |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Chemistry Letters, 11, p. 101, 1982 |
|||||
Synonym Chemical Name(s) | |||||
|
3-imino-3-(p-tolyl)-2-thioformyl-propionitrile |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
1,1-diethoxy-3-nonyne | (3Z)-3-nonenal (31823-43-5) | bromocyclopropane (4333-56-6) | (3E)-7-(methylsulfanyl)-7-thioxo-3-heptenoic acid | 2-methoxy-1-phenyl-2-phenylsulfanylethanone | (2Z)-4-methoxy-3-phenyl-4-(phenylsulfanyl)-2-buten-1-ol | 3-phenylfuran | methyl 4-oxodecanoate | methyl 4-oxobutanoate (13865-19-5) | methyl 5-hydroxy-4-oxopentanoate | 1-(4-nitrophenyl)ethanone (100-19-6) | (3E)-3-octene-2,7-dione | [(1E)-3,3,3-trifluoro-1-propenyl]benzene | 1-(trifluoromethyl)-prop-2-enyl-benzene | 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-1-heptene | trifluoromethyl-benzene (98-08-8) | [(1E)-3,4,4,4-tetrafluoro-3-(trifluoromethyl)-1-butenyl]benzene | 3-chloro-2-(chloromethyl)-1-hexene | (3E)-4-methyl-3-decen-2-one | (3E)-10-hydroxy-3-decenoic acid | (3E)-9-oxo-3-decenoic acid | ethyl 2-pyrrolidinylacetate (5027-77-0) | (5E)-5-ethyl-6-iodo-5-decene | (1E)-1-iodo-2-methyl-1-heptene | phenylacetaldehyde (122-78-1) | |
|||||
