(2E)-3,7-dimethyl-2,6-octadienyl 4-methylphenyl sulfone |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C17H24O2S |
||||
Molecular Weight: |
292.442 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
YPBZFJKZSDUEID-NTCAYCPXBK |
||||
Smiles: |
CC(C)=CCC\C(C)=C\C[S](=O)(=O)C1=CC=C(C)C=C1 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Chemistry Letters, 10, p. 1357, 1981 |
|||||
Synonym Chemical Name(s) | |||||
|
1-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfonyl-4-methylbenzene |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Here you have an access to the other substances | |||||
|
octyl octanoate (2306-88-9) | Jasmone (488-10-8) | 2-butyl-3-methyl-2-cyclopenten-1-one (14211-72-4) | 1-phenyl-1-octanone (1674-37-9) | methyl 2-oxo-1-oxaspiro[4.4]nonane-4-carboxylate | dimethyl (2Z)-2-(1-hydroxy-1-methylethyl)-2-butenedioate | ethynylbenzene (536-74-3) | (2E,4E)-2,4-hexadienoic acid (5309-56-8) | (3E)-4-phenyl-3-pentenoic acid | 2,2,3,3,4,4,4-heptafluoro-1-phenyl-1-butanol | 1-(2-benzyl-2,5-dihydro-2-thienyl)ethanone | (5E)-5-benzyl-5,7-octadien-4-one | 1-methyl-4-prop-2-enylsulfonylbenzene (3112-87-6) | 1-[(2E)-2-heptenylsulfonyl]-4-methylbenzene | (3E)-3-methyl-3-penten-2-one (565-62-8) | 3-[(2E)-2-pentenyl]-4-pentylfuran | thiobenzoic acid S-tert-butyl ester | 3-ethoxy-2-ethylpentanal | 3-methyl-2,3-pentanediol (63521-37-9) | 1,1-diethoxy-2-propanol | 2,2-dimethoxyethanol (30934-97-5) | pinacol (76-09-5) | 2-acetylcyclobutanone | 1-(4-chlorophenyl)-3-buten-1-ol (14506-33-3) | 4-phenylbutanoic acid (1821-12-1) | |
|||||
