tert-butyl 4-methoxy-1-piperidinecarboxylate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C11H21NO3 |
||||
Molecular Weight: |
215.293 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
WATASAJREKAPOT-UHFFFAOYAU |
||||
Smiles: |
COC1CCN(CC1)C(=O)OC(C)(C)C |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Tetrahedron, 62, p. 6869, 2006 DOI: 10.1016/j.tet.2006.04.095 |
|||||
Synonym Chemical Name(s) | |||||
|
4-methoxy-piperidine-1-carboxylic acid tert-butyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
2-ethoxy-3-pyridinylboronic acid (854373-97-0) | 5,6-dibromo-2-indanol | 5,6-dimethoxy-2-indanol | 5-bromo-2-indanol | 5-bromo-2,3-dihydro-1H-inden-2-ylamine (73536-88-6) | 1H-indol-3-ylmethanamine (22259-53-6) | 3-butyl-2-phenyl-1H-indole | 3-butyl-2-methyl-1H-indole | 2-ethyl-3-propyl-1H-indole | methyl 3-methyl-2-phenyl-1H-indol-5-yl ether | 1-ethynyl-4-nitrobenzene (937-31-5) | 3-Ethynylpyridine (2510-23-8) | 6,7-dimethyl-2H-chromen-2-one | 6-methyl-2H-chromen-2-one (92-48-8) | 6-bromo-2H-chromen-2-one (19063-55-9) | 7-methoxy-2H-chromen-2-one (531-59-9) | 2-chloro-5-ethylnicotinaldehyde | 2-chloro-5-propylnicotinaldehyde | 2-chloro-5-isopropylnicotinaldehyde | 2-chloro-5-pentylnicotinaldehyde | methyl 6-chloro-5-formyl-2-pyridinecarboxylate | 3-ethoxy-1H-indole | 3-ethoxy-4-methyl-1H-indole | methyl 3-ethoxy-1H-indole-4-carboxylate | 3-ethoxy-6-nitro-1H-indole | |
|||||
