methyl 4,4-dichloro-2-methyl-5-oxotetrahydro-2-furancarboxylate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C7H8Cl2O4 |
||||
Molecular Weight: |
227.044 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
CIJABRVWRSMVET-UHFFFAOYAM |
||||
Smiles: |
COC(=O)C1(C)CC(Cl)(Cl)C(=O)O1 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Chemistry Letters, 8, p. 1011, 1979 |
|||||
Synonym Chemical Name(s) | |||||
|
methyl 4,4-dichloro-2-methyl-5-oxooxolane-2-carboxylate |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
3-methyl-1,4-dithiepan-2-one | [(2E,4E,6E)-1-allyl-2,4,6-octatrienyl]cyclopropane | 1,4-dichlorobenzene (106-46-7) | 1,4-dibromobenzene (106-37-6) | 1-bromo-4-iodobenzene (589-87-7) | 1-bromo-4-methylsulfanylbenzene (104-95-0) | 1,1'-biphenyl (92-52-4) | 1H-indol-4-yl-N-methylmethanamine (94980-84-4) | 3-allylcyclohexanone | (1E)-1-fluoro-1-octene | 1,1-difluoro-1-octene | 3-chloro-5-phenyloxolan-2-one | ethyl 2-cyclohexylidenepropanoate | ethyl (2Z)-(3,3-dimethylcyclohexylidene)ethanoate (37722-77-3) | 3-(phenylsulfonyl)dihydro-2(3H)-furanone | (1E)-1-phenyl-1-hepten-3-one (41903-83-7) | 1-(6,10-dimethyl-1-azaspiro[4.5]dec-3-yl)ethanone | 1-(5-phenyl-2-pyrrolidinyl)ethanone | 3-ethylsulfanyl-1,3-diphenylpropan-1-one | 1-(methylsulfanyl-methoxy)-octane | [(E)-1-chloro-2-iodoethenyl]benzene | [(Z)-2-bromo-1-chloroethenyl]benzene | 2-methylolbutyric acid methyl ester | 3-methyl-2-methylol-butyric acid methyl ester | (2Z)-2-pentyl-2-heptenenitrile | |
|||||
