|
6H-chromeno[4,3-b]quinoline |
Molecular Formula: |
C16H11NO |
Molecular Weight: |
233.269 g/mol |
|
|
Registry Numbers |
Cas Number: 225-55-8 |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
FBFLIZGARFAIRP-UHFFFAOYAE |
Smiles: |
C1OC2=C(C=CC=C2)C3=C1C=C4C=CC=CC4=N3 |
![Chemical structure of 6H-chromeno[4,3-b]quinoline](/molimg/1/big/31/31732.gif) |
Synthesis Reference |
|
Tetrahedron Letters, 24, p. 2379, 1983 DOI: 10.1016/S0040-4039(00)81930-9 |
|
|
Synonym Chemical Name(s) |
|
6H-chromeno[4,3-b]chinolin 6H-chromeno[4,3-b]quinoline 6H-クロメノ[4,3-b]キノリン
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Quinolines
|
Here you have an access to the other substances |
|
ethyl 3-methyl-3-cyclohexene-1-carboxylate |
tert-butyl 5-tert-butyl-2-methyl-1,3-oxazole-4-carboxylate |
2-methoxy-1-nonen-3-one |
2,3-nonanedione |
2-methoxy-1-hexen-3-one |
1-cyclohexyl-2-methoxy-2-propen-1-one |
7-chloro-2-methoxy-1-hepten-3-one |
5-(1-hydroperoxy-1-methoxyethyl)-2-methylcyclohexanone |
4-acetyl-7-methyl-2-oxepanone |
2-(2-hydroperoxy-2-methoxycyclohexyl)-1-methylethyl acetate |
3-methyl-1-phenyl-1,2-butanedione |
5-methylsulfanyl-pentane-2,3-dione |
3,3-dichloro-4-(chloro-phenylmethyl)oxolan-2-one |
3,3-dichloro-4-(1-chloroethyl)dihydro-2(3H)-furanone |
7-methoxy-3-methyl-1H-indole |
1-cyclohexyl-2-phenylethanone (61259-29-8) |
(3E)-1,4-diphenyl-3-buten-2-one (5409-59-6) |
1-(2-furyl)-2-phenylethanone |
methyl 4-oxo-5-phenylpentanoate |
4-acetonylbenzonitrile (58949-75-0) |
methyl (4-oxo-2-cyclohexen-1-yl)acetate |
3-ethynylfuran (51061-85-9) |
2-furan-3-ylethyl acetate |
(7E,9E)-7,9-dodecadien-1-ol (54364-60-2) |
(5E,7E)-5,7-hexadecadiene |
|
|