|
5H-benzo[b]carbazole |
Molecular Formula: |
C16H11N |
Molecular Weight: |
217.27 g/mol |
|
|
Registry Numbers |
Cas Number: 243-28-7 |
EINECS Number: n/a |
MDL Number: MFCD02316988 |
|
InChIKey: |
ROEOVWIEALGNLM-UHFFFAOYAS |
Smiles: |
[NH]1C2=C(C=CC=C2)C3=C1C=C4C=CC=CC4=C3 |
![Chemical structure of 5H-benzo[b]carbazole](/molimg/1/big/31/31963.gif) |
Synthesis Reference |
|
Tetrahedron Letters, 24, p. 5435, 1983 DOI: 10.1016/S0040-4039(00)94105-4 |
|
|
Synonym Chemical Name(s) |
|
5H-benzo[b]carbazol 5H-benzo[b]carbazole 5H-ベンゾ[b]カルバゾール
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Indoles Naphthalenes Carbazoles
|
Here you have an access to the other substances |
|
2-(phenoxycarbonylamino)acetic acid |
2-(1-hydroxycyclohexyl)-1-phenyl-1-propanone |
(4Z)-8-hydroxy-9-methyl-4,9-decadienenitrile |
(2E)-1-phenyl-2-buten-1-ol (3347-57-7) |
1-(1-cyclohexen-1-yl)-1-nonanol |
1,2-diphenyl-2-propen-1-ol |
(2E)-2-methyl-1,3-diphenyl-2-propen-1-ol |
1-methyl-4-[(1E)-5-methyl-1,4-hexadienyl]-1-cyclohexene |
2-propyl-2,3-dihydro-4H-pyran-4-one |
methyl 2-oxo-3-cyclohexene-1-carboxylate |
methyl 3-methyl-2-oxocyclohexanecarboxylate |
4-(phenylsulfonyl)-4H-furo[3,4-b]indole |
1-methyl-2-styryl-benzene (74685-42-0) |
N-(2-dimethylaminoethyl)-N,2-dimethylbenzamide |
1-(4-chloro-2-methylphenyl)ethanone (37074-38-7) |
2-chloroanthra-9,10-quinone (131-09-9) |
2-methoxyanthra-9,10-quinone (3274-20-2) |
9,10-dioxo-9,10-dihydro-2-anthracenyl acetate |
2-nitroanthra-9,10-quinone |
6-methyl-2-octanone (925-69-9) |
6,6-dimethyl-2-heptanone |
4,4-dimethyl-2-nonanone |
4,4,6-trimethyl-2-octanone |
3-pentylcyclopentanone |
(5E,9E)-6,10,14-trimethyl-5,9,13-pentadecatrienal |
|
|