7-nitro-4-phenyl-3,4-dihydro-2H-1,4-benzoxazine |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C14H12N2O3 |
||||
Molecular Weight: |
256.261 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
HJOWNEMXKUQOHQ-UHFFFAOYAW |
||||
Smiles: |
[O-][N+](=O)C1=CC2=C(C=C1)N(CCO2)C3=CC=CC=C3 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Chemistry Letters, 7, p. 931, 1978 |
|||||
Synonym Chemical Name(s) | |||||
|
7-nitro-4-phenyl-3,4-dihydro-2H-[1,4]benzoxazine |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
(4E)-4-hexenylbenzene (23086-43-3) | (4E)-4-octenylbenzene | 5-cyclohexyl-penta-3,4-dienyl-benzene | 2,3-dimethyleneoctahydro-1-benzofuran | 2-methyl-1-nonen-8-yne | 1-phenyl-4-penten-1-one (3240-29-7) | 2-phenyl-4-pentenal (122800-80-0) | 1,2-nonadiene | 1-bromohexane (111-25-1) | (2E)-2-propyl-2-hexenal | 1-chlorohexadecane (4860-03-1) | 3-vinyl-1,3-dodecadiene | 8-nitro-5-phenyl-2,3,4,5-tetrahydro-1,5-benzoxazepine | tri[(4E)-4-hexenyl]borane | (4E)-4-hexen-1-ol (928-91-6) | 5-cyclopropyl-tetrahydro-furan-2-one | 1-methyl-2-phenoxyethyl acetate (5413-56-9) | ethyl 3-aminopropanoate (924-73-2) | N-benzyl-N-octylhydroxylamine | N-octyl-1-phenylmethanimine | 2-ethyl-5-phenyl-1,3-oxazole | 1-undecene (821-95-4) | 1,1-bis(methylsulfanyl)-1,3-butadiene | 4-methyl-4,5-dihydropyrrolo[4,3,2-de]isoquinolin-2(1H)-one | 2-[4-(dimethylaminomethyl)-1H-indol-3-yl]-acetonitrile | |
|||||
