|
(5E)-6-phenyl-5-hexenoic acid |
Molecular Formula: |
C12H14O2 |
Molecular Weight: |
190.242 g/mol |
|
|
Registry Numbers |
Cas Number: 16424-56-9 |
EINECS Number: n/a |
MDL Number: MFCD07369634 |
|
InChIKey: |
GPGLPAFSJGVMEH-TVJGSOIMDQ |
Smiles: |
OC(=O)CCC/C=C/C1=CC=CC=C1 |
 |
Synthesis Reference |
|
Tetrahedron Letters, 22, p. 4185, 1981 DOI: 10.1016/S0040-4039(01)82099-2
|
|
|
Synonym Chemical Name(s) |
|
(E)-6-phenyl-hex-5-enoic acid
(E)-6-phenylhex-5-enoic acid
(E)-6-phenylhex-5-ensäure
acide (E)-6-phénylhex-5-enoic
(E)-6-フェニルヘx-5-エン酸
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Carboxylic acids
|
Here you have an access to the other substances |
|
2,2-dimethyl-3,5-diphenylpyrrolidine |
3,4-dimethyl-1,5-hexadiene-3,4-diol |
(5Z)-5-decen-2-ol |
(4E)-5-phenyl-4-pentenal |
1,1-bis(methylsulfanyl)-1-heptene |
1,2,2-tris(methylsulfanyl)-vinyl-cyclopropane |
7-(2-formyl-5-hydroxycyclopentyl)heptanoic acid |
(2E)-N,N-diisopropyl-2,4-pentadienamide |
5,5-dimethyl-6-methylene-1-cyclohexene-1-carbaldehyde |
methyl (2Z)-3-(benzyloxy)-2-propenoate |
methyl 3-methoxy-3-phenylmethoxypropanoate |
benzoic acid 1-carbomethoxyvinyl ester |
1,6-cyclodecadiene (1124-79-4) |
5-(1-bromo-2-methyl-1-propenyl)dihydro-2(3H)-furanone |
2-(1-bromo-2-methyl-1-propenyl)tetrahydro-2H-pyran |
(3E)-3-benzylidenetetrahydro-2H-pyran |
4-(4-methylphenyl)butanal |
4-pentenethioamide |
N-allyl-N-phenylpentanethioamide |
4-ethyl-2-hexyl-1H-pyrrole |
2-methoxyoctanenitrile |
1,11-dihydroxy-5,12-naphthacenedione |
2-methylene-3-oxocyclopentanecarboxylic acid (874-21-5) |
1-(phenylsulfonyl)bicyclo[1.1.0]butane |
1-decyl-1-[(1E)-1-octenyl]cyclopropane |
|
|