|
indeno[2,1-b]pyrrole |
Molecular Formula: |
C11H7N |
Molecular Weight: |
153.183 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
CNAFOLPGHNAMBW-UHFFFAOYAI |
Smiles: |
C1=CC=C2C(=C1)C=C3N=CC=C23 |
![Chemical structure of indeno[2,1-b]pyrrole](/molimg/1/big/34/34799.gif) |
Synthesis Reference |
|
Tetrahedron Letters, 4, p. 163, 1963 DOI: 10.1039/jr9630005127 |
|
|
Synonym Chemical Name(s) |
|
indeno[2,1-b]pyrrol indeno[2,1-b]pyrrole インデノ[2,1-b]ピロール
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Indenes
|
Here you have an access to the other substances |
|
2-amino-3a,4,7,7a-tetrahydro-1H-indene-3-carbonitrile |
4-Cyclohexene-1,2-diacetic acid (25050-73-1) |
ethyl 2-oxo-2,3,3a,4,7,7a-hexahydro-1H-indene-1-carboxylate |
2-diazocyclohexanone |
2-(3-nitropropyl)benzonitrile |
2,2-diisopropyl-3-methylbutanoic acid |
7-methyl-1H-benzimidazole (4887-83-6) |
3-cyclopenten-1-ylacetic acid |
spiro[2.7]decan-4-one |
methyl 2-phenylhydrazinecarboxylate (2290-03-1) |
heptane (142-82-5) |
4-(6-oxo-1-cyclohexen-1-yl)butanenitrile |
dimethyl 2,3-dihydroxy-2,3-dimethylsuccinate |
1-bromo-3,4,4-trimethyl-1,2-pentadiene |
5-bromo-1,2-pentadiene |
3-bromo-1-propyne (106-96-7) |
2-(1-phenylethylidene)malononitrile (5447-87-0) |
10-(3-dimethylamino-propyl)-9H-anthracene-9,10-diol |
1-butanesulfonic acid (2386-47-2) |
Coumestrol (479-13-0) |
1,2,3,4-tetrahydro-9-acridinamine (321-64-2) |
methyl 1-naphthoate (2459-24-7) |
3,4,5-pyridazinetrithiol |
2-phenyl-4,5-bis-sulfanylpyridazin-3-one (3042-86-2) |
6,7,8,9-tetrahydro-5H-benzo[a]cycloheptene (1075-16-7) |
|
|