dimethyl 2,6-bis(dimethylamino)-4,5-pyrimidinedicarboxylate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C12H18N4O4 |
||||
Molecular Weight: |
282.299 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
LMCQDUAAZKPVPQ-UHFFFAOYAV |
||||
Smiles: |
COC(=O)C1=NC(=NC(=C1C(=O)OC)N(C)C)N(C)C |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Chemistry Letters, 20, p. 2043, 1991 |
|||||
Synonym Chemical Name(s) | |||||
|
2,6-bis(dimethylamino)-pyrimidine-4,5-dicarboxylic acid dimethyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
2-tert-butoxy-2-methylpropane (6163-66-2) | 3-tert-butoxy-3-methyl-1-butyne | 4-methyl-2-(1-methylcyclohexyl)quinoline | 1-cyclohexylphthalazine | (E)-N,N,N',N'-tetramethyl-1,2-diphenylethene-1,2-diamine | 5-tert-butyl-2-oxepanone | 2-oxocanone (539-87-7) | methyl 2-hydroxyundecanoate | methyl 2-hydroxy-4-phenylbutanoate | 1-(4-iodophenyl)ethanol | 2-(4-fluorophenyl)-3-pentyloxirane | 1-phenyl-1-butanol (614-14-2) | 1-methyl-3-propoxybenzene | 3-(3,5-dimethylphenoxy)-1-propanol | 5-ethoxy-1,2,3-trimethylbenzene | ethyl 4,8-dimethyl-7-nonenoate | 3-hexynyl 4-methylpentanoate | N,N-dibenzyl-2-methylbutanamide | N-phenylacetamide (103-84-4) | Coumarin (91-64-5) | 2-(4-methyl-2-quinolinyl)ethanol | 4-hydroxy-3-methyl-4-phenyl-2-butanone | (5E)-3-allyl-4-hydroxy-5-hepten-2-one | 2,2,3-trifluorobutane | 1-chloro-1,2,2-trifluoropropane | |
|||||
