|
2-phenyl-1H-indole |
Molecular Formula: |
C14H11N |
Molecular Weight: |
193.248 g/mol |
|
|
Registry Numbers |
Cas Number: 948-65-2 |
EINECS Number: 213-436-3 |
MDL Number: MFCD00005608 |
|
InChIKey: |
KLLLJCACIRKBDT-UHFFFAOYAH |
Smiles: |
[NH]1C2=C(C=CC=C2)C=C1C3=CC=CC=C3 |
 |
Synthesis Reference |
|
Chemistry Letters, 21, p. 769, 1992 Journal of Heterocyclic Chemistry, 29, p. 1085, 1992 Tetrahedron Letters, 33, p. 1459, 1992 DOI: 10.1016/S0040-4039(00)91646-0 |
|
|
Synonym Chemical Name(s) |
|
2-phenyl-1H-indole 2-phényl-1H-indole 2-フェニル-1H-インドール
|
Physical Properties |
Melting Point: 188-191 ºC
Boiling Point: 250 ºC
(10 mmHg) |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Indoles
|
Here you have an access to the other substances |
|
2,2,3-trifluorobutane |
1-chloro-1,2,2-trifluoropropane |
1-anilino-1-phenyl-2-heptanone |
4-benzothioylmorpholine (2032-36-2) |
1-(4-methoxy-3-methylphenyl)-1-hexanone |
3-phenyl-2-cyclopenten-1-one (3810-26-2) |
1-benzyl-3,5-dimethyl-1H-pyrazole (1134-81-2) |
4-phenylbutanal (18328-11-5) |
tetralin-1-one (529-34-0) |
2-(4-methoxyphenyl)-4H-pyrazolo[1,5-a]indole |
2-phenyl-3a,4-dihydro-3H-pyrazolo[1,5-a]indol-3-ol |
1-(methoxymethoxy)-4-methyl-2-(trifluoromethyl)benzene |
1-oxo-1,2,3,4-tetrahydro-2-naphthalenecarboxylic acid |
2-cyano-2-phenylacetic acid (14025-79-7) |
(2E)-2-nitro-2-butene (4812-23-1) |
1-nitro-ethylidene-cyclohexane |
5-tert-butyl-1,3-oxathiolane |
4-methyl-2,3-diphenyltetrahydro-3-thiophenol |
ethyl 3-cyano-3-dimethylamino-2,2-difluoropropanoate |
ethyl 3-dimethylamino-2,2-difluoro-5-oxo-5-phenylpentanoate |
1-(phenylethynyl)-2-(phenylsulfanyl)benzene |
1-(fluoromethyl)-4-nitrobenzene |
2-tert-pentylquinoline |
2-tert-pentylisonicotinonitrile |
2-hydroxy-4-phenylbutanoic acid (4263-93-8) |
|
|