|
1,3,4,5-tetrahydrobenzo[cd]indole |
Molecular Formula: |
C11H11N |
Molecular Weight: |
157.215 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
GESDFCMCXNVUOI-UHFFFAOYAY |
Smiles: |
C1CC2=C[NH]C3=CC=CC(=C23)C1 |
![Chemical structure of 1,3,4,5-tetrahydrobenzo[cd]indole](/molimg/1/big/38/38261.gif) |
Synthesis Reference |
|
Tetrahedron Letters, 25, p. 285, 1984 DOI: 10.1016/S0040-4039(00)99863-0 |
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Indoles
|
Here you have an access to the other substances |
|
(5E)-5-dihydro-2(3H)-furanylidene-2-pentanol |
2-benzylsulfanyl-ethylsulfonyl-benzene |
2-heptyl-1,3-butadiene |
5-iodo-2-pentanol |
(5Z)-5-undecenenitrile |
(4E,7Z)-4,7-tridecadienenitrile |
2-iodo-4-methylcyclohexanone |
4-bromo-1-butene (5162-44-7) |
3-phenylpropionaldoxime (1197-50-8) |
valeraldoxime |
ethyl (5-phenyl-1-cyclohexen-1-yl)acetate |
4-isocyanato-1-cyclohexene |
6-methoxy-5-nitro-tetralin-2-one |
8-methoxy-1,3,4,5-tetrahydrobenzo[cd]indole |
4,5-dichloro-4,5,5-trifluoro-1-pentene |
4,4,5,5,6,6,6-heptafluoro-1-hexene |
5-bromo-4-chloro-4,5,5-trifluoro-1-pentene (356-73-0) |
[(6E)-6-nonenylsulfanyl]benzene |
[(4E)-4-hexenylsulfanyl]benzene |
1-nitro-4-phenylsulfanylbenzene (952-97-6) |
(3Z)-3-methyl-4-phenyl-3-buten-1-ol |
methyl (E)-cyanomethylimidoformate |
1H-imidazol-5-yl methyl ether |
3-ethylcyclopentanone (10264-55-8) |
Dibromoformaldoxime (74213-24-4) |
|
|