|
3,5-ditert-butylaniline |
Molecular Formula: |
C14H23N |
Molecular Weight: |
205.343 g/mol |
|
|
Registry Numbers |
Cas Number: 2380-36-1 |
EINECS Number: 219-173-0 |
MDL Number: MFCD00134096 |
|
InChIKey: |
MJKNHXCPGXUEDO-UHFFFAOYAW |
Smiles: |
CC(C)(C)C1=CC(=CC(=C1)N)C(C)(C)C |
 |
Synthesis Reference |
|
Canadian Journal of Chemistry, 41, p. 1653, 1963 DOI: 10.1139/v63-238
|
|
|
Synonym Chemical Name(s) |
|
(3,5-ditert-butyl-phenyl)-amine
(3,5-ditert-butylphenyl)amine
3,5-ditert-butylanilin
3,5-ditert-butylaniline
3,5-ジtert-ブチルアニリン
|
Physical Properties |
Melting Point: 54-57 ºC
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Primary amines
|
Here you have an access to the other substances |
|
2-(cyclohexylideneamino)-1-cyclohexene-1-carboxamide (7149-51-1) |
(E)-N-(1-methoxyethylidene)-4-methylbenzenesulfonamide |
2-(1H-indol-3-yl)ethanol (526-55-6) |
benzyl 3-methyl-1H-indol-5-yl ether |
7-Nitro-1H-indole (6960-42-5) |
ethyl 2-oxocyclohexanecarboxylate (1655-07-8) |
4-(trifluoromethyl)phthalic acid (835-58-5) |
1-iodo-2-pentanol |
4-(2-bromoethyl)-3,5-dimethylpyridine |
1-(3,5-dimethyl-4-pyridinyl)ethanone |
4-oxocycloheptyl benzoate |
(2Z,5Z)-2,6-bis(ethylamino)-2,5-heptadien-4-one |
1,5-diphenyl-1H-1,2,4-triazole-3-carboxylic acid (24058-92-2) |
triethyl 2-fluoro-1-oxo-1,2,3-propanetricarboxylate |
diethyl 2-fluorosuccinate |
ethylphosphonothioic dichloride (993-43-1) |
tetrachloro-ethylphosphorane |
Dichloroethylphosphine (1498-40-4) |
7-fluoro-1-heptyne (353-15-1) |
(4E)-4-nonen-1-ol |
3,3,8-trimethyl-2,7-dioxaspiro[4.4]nonane |
diethyl 2-methylhexanedioate |
ethyl 1-methyl-2-oxocyclopentanecarboxylate (5453-88-3) |
methoxybenzene (100-66-3) |
4-benzylsulfanyl-1H-indole |
|
|