1,5-diphenyl-1H-1,2,4-triazole-3-carboxylic acid |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C15H11N3O2 |
||||
Molecular Weight: |
265.271 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
RBJKFWPNGGRTOV-LILDFLRNCN |
||||
Smiles: |
OC(=O)C1=N[N](C2=CC=CC=C2)C(=N1)C3=CC=CC=C3 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Canadian Journal of Chemistry, 41, p. 1813, 1963 DOI: 10.1139/v63-260 |
|||||
Synonym Chemical Name(s) | |||||
|
1,5-diphenyl-1H-[1,2,4]triazole-3-carboxylic acid |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
(E)-N-(1-methoxyethylidene)-4-methylbenzenesulfonamide | 2-(1H-indol-3-yl)ethanol (526-55-6) | benzyl 3-methyl-1H-indol-5-yl ether | 7-Nitro-1H-indole (6960-42-5) | ethyl 2-oxocyclohexanecarboxylate (1655-07-8) | 4-(trifluoromethyl)phthalic acid (835-58-5) | 1-iodo-2-pentanol | 4-(2-bromoethyl)-3,5-dimethylpyridine | 1-(3,5-dimethyl-4-pyridinyl)ethanone | 4-oxocycloheptyl benzoate | (2Z,5Z)-2,6-bis(ethylamino)-2,5-heptadien-4-one | 3,5-ditert-butylaniline (2380-36-1) | triethyl 2-fluoro-1-oxo-1,2,3-propanetricarboxylate | diethyl 2-fluorosuccinate | ethylphosphonothioic dichloride (993-43-1) | tetrachloro-ethylphosphorane | Dichloroethylphosphine (1498-40-4) | 7-fluoro-1-heptyne (353-15-1) | (4E)-4-nonen-1-ol | 3,3,8-trimethyl-2,7-dioxaspiro[4.4]nonane | diethyl 2-methylhexanedioate | ethyl 1-methyl-2-oxocyclopentanecarboxylate (5453-88-3) | methoxybenzene (100-66-3) | 4-benzylsulfanyl-1H-indole | 2,4-diphenyl-2H-1,3-benzoxazine | |
|||||
