|Home|Text Search|Structure Search|About|

6-methyldibenzo[c,e]azocin-5(6H)-one

Molecular Formula:

C16H13NO

Molecular Weight:

235.285 g/mol

Registry Numbers

Cas Number: n/a

EINECS Number: n/a

MDL Number: n/a

InChIKey:

HRIIFPSZGVWOGA-KHPPLWFEBP

Smiles:

CN1\C=C/C2=C(C=CC=C2)C3=C(C=CC=C3)C1=O

Chemical structure of 6-methyldibenzo[c,e]azocin-5(6H)-one

Synthesis Reference

Tetrahedron Letters, 30, p. 5841, 1989 DOI: 10.1016/S0040-4039(01)93485-9

Physical Properties

Melting Point: n/a
Boiling Point: n/a

Density: n/a
Refractive Index: n/a

H1 NMR Spectrum:

Predict NMR spectrum

MSDS:

coming soon

Here you have an access to the other substances

ethyl methyl(1-phenylpropyl)carbamate | (3E)-3-undecene | 5-ethyl-6-tetradecanone | (6Z)-6-dodecenal | 4-(1-methyl-4,5-dihydro-1H-pyrrol-3-yl)-2-butanone | 2,7-dimethyl-4,5,6,7-tetrahydropyrano[2,3-b]pyrrole | 4-(3-methyl-1,2,3,4-tetrahydro-1-naphthalenyl)phenol | 2-methylbenzaldehyde oxime (3376-32-7) | 2-chloro-3-methyl-3-buten-1-ol | 6-methoxy-2-propan-2-ylisoquinolin-1-one | 6-methoxy-4-(4-methoxyphenyl)-2-methyl-1,2,3,4-tetrahydroisoquinoline | N-methyl-N-styryl-benzamide | methyl 1-methyl-2-phenyl-1H-pyrrole-3-carboxylate | N-(1-benzylhexyl)benzamide | 4-cyclopentylidene-3-propan-2-ylideneoxetan-2-one | 3,4-diisopropylidene-oxetan-2-one | 4-[(E)-2-(3-pentynyloxy)ethenyl]morpholine | 3-methyl-2-morpholin-4-ylpenta-3,4-dienal | 2-butynyl (1E)-2-(4-morpholinyl)-1-propenyl ether | 5-hydroxy-2-methyl-5-phenyl-1-penten-3-one | 5-[(E)-2-(phenylsulfanyl)ethenyl]-1,3-benzodioxole | 5-(3-phenylsulfanyl-oxiran-2-yl)-1,3-benzodioxole | 2-butyltetrahydro-2H-pyran | 2-cyclohexyl-3-[(1E)-4,4-diethoxy-1-butenyl]oxirane | 2-[(1E)-1-butyl-1-hexenyl]naphthalene |