tert-butyl 2-nitro-1H-indole-1-carboxylate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C13H14N2O4 |
||||
Molecular Weight: |
262.265 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
UCHLVDQEISHRBV-UHFFFAOYAR |
||||
Smiles: |
CC(C)(C)OC(=O)[N]1C2=C(C=CC=C2)C=C1[N+]([O-])=O |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Tetrahedron Letters, 43, p. 4115, 2002 DOI: 10.1016/S0040-4039(02)00696-2 |
|||||
Synonym Chemical Name(s) | |||||
|
2-nitro-1H-indole-1-carboxylic acid tert-butyl ester |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
2,3-diamino-4,6-dimethylbenzonitrile (344595-76-2) | methyl 2,3-diamino-4,6-dimethylbenzoate | 4-methyl-1,2-benzenediamine (496-72-0) | 4,5-Dimethyl-1,2-phenylenediamine (3171-45-7) | 2-Aminoimidazole hemisulfate (1450-93-7) | Resveratrol (501-36-0) | 2-benzoylcyclohexanone (3580-38-9) | 4-hydroxy-3-methoxy-2H-chromen-2-one | 3-ethoxy-4-hydroxy-2H-chromen-2-one | 4-hydroxy-3-phenylmethoxychromen-2-one | tert-butyl 1H-indole-1-carboxylate (75400-67-8) | tert-butyl 3-methyl-1H-indole-1-carboxylate | tert-butyl 3-methyl-2-nitro-1H-indole-1-carboxylate | 2-nitro-1H-indole (60544-75-4) | 3-methyl-2-nitro-1H-indole (19869-26-2) | Threonine (72-19-5) | Asparagine (70-47-3) | Glutamine (56-85-9) | Histidine (71-00-1) | Arginine (74-79-3) | 2-(Methyl-phenyl-hydrazono)-propionic acid ethyl ester (13867-00-0) | |
|||||
