diethyl 2-methyl-2-[(1E)-1-propenyl]malonate |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C11H18O4 |
||||
Molecular Weight: |
214.262 g/mol |
||||
|
|||||
Cas Number: |
n/a |
||||
InChIKey: |
AGHBFUATCXRRAH-VMPITWQZBQ |
||||
Smiles: |
CCOC(=O)C(C)(/C=C/C)C(=O)OCC |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Journal of the American Chemical Society, 99, p. 4833, 1977 |
|||||
|
|
|||||
Synonym Name(s) | |||||
|
2-methyl-2-[(E)-prop-1-enyl]-propanedioic acid diethyl ester |
|||||
Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
Associated Data Sources | |||||
Here you have an access to the other substances | |||||
|
dimethyl 2-(2-methoxy-2-cyclohexen-1-yl)malonate |
|||||

![diethyl 2-methyl-2-[(1E)-1-propenyl]malonate](/molimg/1/big/5/5348.gif)