|
4-nitrobenzoic acid |
Molecular Formula: |
C7H5NO4 |
Molecular Weight: |
167.121 g/mol |
|
|
Registry Numbers |
Cas Number: 62-23-7 |
EINECS Number: 200-526-2 |
MDL Number: MFCD00007352 |
|
InChIKey: |
OTLNPYWUJOZPPA-BGGKNDAXCX |
Smiles: |
OC(=O)C1=CC=C(C=C1)[N+]([O-])=O |
 |
Synthesis Reference |
|
Canadian Journal of Chemistry, 67, p. 1387, 1989 Journal of the American Chemical Society, 72, p. 5012, 1950 Tetrahedron Letters, 26, p. 2387, 1985 DOI: 10.1016/S0040-4039(00)94834-2 |
|
|
Synonym Chemical Name(s) |
|
4-nitro-benzoic acid 4-nitrobenzoesäure acide 4-nitrobenzoic 4-ニトロ安息香酸
|
Physical Properties |
Melting Point: 239-242 ºC
Boiling Point: n/a |
Density: 1.61 g/mL
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Carboxylic acids
Nitro Compounds
|
Here you have an access to the other substances |
|
2-chlorotetrahydrothiophene |
2-azidotetrahydrothiophene |
3-(4-chlorobut-1-en-2-yl)-2-methylcyclopentan-1-one |
(2E,4Z)-1-methyl-2,4-tridecadienyl acetate |
(2E)-1-octyl-2,4-pentadienyl acetate |
(2E,4Z)-1-methyl-2,4-dodecadienyl acetate |
3-(1,1-dimethyl-4-pentenyl)-2-methyl-2-cyclopenten-1-one |
3-(4-bromo-1,1-dimethylpentyl)-2-methyl-2-cyclopenten-1-one |
2-methyl-3-(2-methylolcyclopropyl)cyclopent-2-en-1-one |
2-methyl-3-(2-methylolcyclobutyl)cyclopent-2-en-1-one |
(9E)-9,11-dodecadienyl acetate (50767-78-7) |
2-fluoro-ethyl-benzene (50561-93-8) |
2-nitrophenol (88-75-5) |
2-methoxy-3-nitrobenzonitrile |
2-methoxy-3-nitrophenol |
2-phenethyl-phenol |
4-bromo-N-methylaniline (6911-87-1) |
4-bromo-1-naphthol (571-57-3) |
1-fluoro-2,4-dimethoxybenzene (17715-70-7) |
1-(3-butenyl)-6-oxo-2,4-cyclohexadien-1-yl acetate |
2-butoxy-1,1,3,3-tetramethylisoindoline |
1-tert-butyl-2,3,3-trimethyl-2-aziridinecarbonitrile |
1-tert-butyl-2,2-dimethyl-1-azaspiro[2.3]hexane-4-carbonitrile |
1-(1-pyrrolidinylmethyl)cyclopentanol |
2-hydroxy-2-phenacylcyclohexan-1-one |
|
|