3-hydroxy-2,3,3-triphenylpropanenitrile |
|||||
|---|---|---|---|---|---|
Molecular (Chemical) Formula: |
C21H17NO |
||||
Molecular Weight (Molar Mass): |
299.372 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
AQROMKCCQRTJFM-UHFFFAOYAU |
||||
|
|
|||||
Smiles: |
OC(C(C#N)C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
||||
Chemical Structure | |||||
![]() |
|||||
Synthesis (Preparation) Reference | |||||
|
Journal of the American Chemical Society, 89, p. 4566, 1967 |
|||||
Synonym Chemical Name(s) | |||||
|
3-hydroxy-2,3,3-triphenyl-propionitrile |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
1,3-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione | 5-methyl-4-indanol | 3-tert-butyl-7-methyl-1,3-dihydro-2H-azepin-2-one | 3a-(1,3-benzodioxol-5-yl)-2,3,3a,5,6,7-hexahydro-4H-indol-4-one | vinylcyclohexane | 3-methyl-1-cyclohexene | 7,7-dimethylnorcaran-2-one | Oxepine | 4-methoxy-2,5,5-trimethyl-4-phenyl-4,5-dihydro-1,3-oxazole | methyl 8-oxobicyclo[4.2.0]octa-1,3,5-triene-7-carboxylate | 1,2,3,4,5,8-hexamethylnaphthalene | 2-methyl-4,5,6,7-tetrahydro-1-benzofuran | (2Z)-2-ethyl-2-penten-1-ol | (2Z)-2-ethyl-2-pentenoic acid | (1Z)-1-bromo-1-pentene | (1E)-1-pentenylcyclohexane | cyclohexyl[(1E)-1-cyclohexyl-1-hexenyl]borinic acid | 1-cyclohexyl-1-hexanone | azidobenzene | isobutyl-thexyl-borane | ethyl 7-methyl-5-oxooctanoate | 1,1,2-trimethyl-propyl-borane | 2-bromocyclohexyl (1E)-N-bromoethanimidoate | 3-(2-norbornyl)propionaldehyde | 3-cyclohexylpropanal | |
|||||
Browse by CAS-Nummer | |||||
|
2962-90-5 | 20294-31-9 | 695-12-5 | 591-48-0 | 291-70-3 | 16403-08-0 | 16403-07-9 | 622-37-7 | 30001-14-0 | 4361-28-8 | |
|||||

