|
(6-oxo-1,2,4,5,6,7-hexahydroazepino[3,2,1-hi]indol-7-yl)acetonitrile |
Molecular Formula: |
C14H14N2O |
Molecular Weight: |
226.278 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
OVCVKGMJIPWFGA-UHFFFAOYAW |
Smiles: |
O=C1CCN2CCC3=CC=CC(=C23)C1CC#N |
![Chemical structure of (6-oxo-1,2,4,5,6,7-hexahydroazepino[3,2,1-hi]indol-7-yl)acetonitrile](/molimg/1/big/6/6335.gif) |
Synthesis Reference |
|
Journal of the American Chemical Society, 88, p. 4061, 1966 DOI: 10.1021/ja00969a030
|
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Indolines
Nitriles
|
Here you have an access to the other substances |
|
8-oxooctanenitrile |
(2Z)-3-tert-butoxy-2-butenenitrile |
4-tert-butylimino-but-3-en-2-one |
N-methyl-3-phenyl-2H-isoindole-1-carboxamide |
methyl 2-oxo-1,2,3,4-tetrahydro-1-naphthalenecarboxylate (31202-23-0) |
2-tert-butoxy-1,3,2-benzodioxaphosphole 2-oxide |
tert-butyl 2-hydroxyphenyl hydrogen phosphate |
2-isopropyl-1-benzothiophene (39743-75-4) |
5-amino-2-methyl-1,3-oxazole-4-carbonitrile (5098-16-8) |
Adenine (73-24-5) |
1,1-dimethyl-2-thioxohydrazine |
1-indolinamine (7633-56-9) |
1-indolin-7-ylacetone |
amino(4-hydroxy-3-nitrophenyl)acetic acid (132203-87-3) |
5-(4-methoxyphenoxy)-1-phenyl-1H-tetraazole |
2,3-diisopropylidene-1,1-dimethyl-cyclopropane |
4-methoxyphenyl benzoate (1523-19-9) |
1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl hypofluorite |
3-(4-nitrophenyl)-3H-diazirene |
6,6-diphenylbicyclo[3.1.0]hex-3-en-2-one |
6H-benzo[c]chromen-6-one (2005-10-9) |
2,3-dihydroxy-1,4-diphenyl-1,4-butanedione |
S-methyl 2-oxo-2-phenylethanethioate |
Methyl phenacyl sulfoxide (2813-22-1) |
2-hydroxy-2-methylsulfanyl-1-phenylethanone |
|
|