|
Beta-Methylcinnamic Acid |
Molecular Formula: |
C10H10O2 |
Molecular Weight: |
162.188 g/mol |
|
|
Registry Numbers |
Cas Number: 1199-20-8 |
EINECS Number: n/a |
MDL Number: MFCD00053500 |
|
InChIKey: |
PEXWJYDPDXUVSV-LDAQOKDMDI |
Smiles: |
CC(=C\C(O)=O)/C1=CC=CC=C1 |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 86, p. 2645, 1964 DOI: 10.1021/ja01067a026
Tetrahedron Letters, 36, p. 2469, 1995 DOI: 10.1016/0040-4039(95)00285-K
|
|
|
Synonym Chemical Name(s) |
|
(E)-3-phenyl-but-2-enoic acid
(E)-3-phenylbut-2-enoic acid
(E)-3-phenylbut-2-ensäure
acide (E)-3-phénylbut-2-enoic
(E)-3-フェニルブタ-2-エン酸
|
Physical Properties |
Melting Point: 79-81 ºC
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Carboxylic acids
|
Here you have an access to the other substances |
|
2-keto-2-methyl-4a,5,6,7,8,8a-hexahydro-1H-isothiochromen-4-one |
1,6-dimethyl-1,5,9-cyclododecatriene |
1-(2,4-dimethoxy-6-methylphenyl)acetone |
10,12-dihydro-4H,6H-[2]benzothiepino[6,5,4-def][2]benzoxepine |
3-cyclohexylidenepropanoic acid |
9-sulfinyl-9H-fluorene |
dimesitylmethanone oxohydrazone |
2-(diazo-mesityl-methyl)-1,3,5-trimethyl-benzene |
1,4-diphenyl-1H-1,2,3-triazole (13148-78-2) |
N-diethylaminodiazenyl-N-ethylethanamine (13304-29-5) |
(3,3-difluorocyclobutyl)benzene |
3-phenylcyclobutanone (52784-31-3) |
(2Z)-(3,4-diethyl-5-oxo-2(5H)-furanylidene)ethanenitrile |
(2,6,6-trimethyl-1-cyclohexen-1-yl)methyl vinyl ether |
(1,3,3-trimethyl-2-methylenecyclohexyl)acetaldehyde |
dichloromethyl pivalate |
2,3-dihydro-1H-pyrrolizine (13618-87-6) |
2,4,4-trimethylcyclohexanone (2230-70-8) |
4-ethyl-3-hexanone (6137-12-8) |
cyclodecanone (1502-06-3) |
1-octadecene (112-88-9) |
1,2,5,7-tetramethyl-1H-azuleno[1,8-bc]pyridine |
N,N,2,2-tetramethyl-1-propanamine (10076-31-0) |
N,3,7-trimethyl-oct-6-en-1-imine oxide |
diethyl 4-methoxybenzoylphosphonate (16703-95-0) |
|
|