|
2,2-diphenylethanol |
Molecular Formula: |
C14H14O |
Molecular Weight: |
198.265 g/mol |
|
|
Registry Numbers |
Cas Number: 1883-32-5 |
EINECS Number: 217-543-6 |
MDL Number: MFCD00004729 |
|
InChIKey: |
NYLOEXLAXYHOHH-UHFFFAOYAD |
Smiles: |
OCC(C1=CC=CC=C1)C2=CC=CC=C2 |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 78, p. 5694, 1956 DOI: 10.1021/ja01602a063 The Journal of Organic Chemistry, 26, p. 4199, 1961 |
|
|
Synonym Chemical Name(s) |
|
2,2-diphenyl-ethanol 2,2-diphenylethanol 2,2-diphényléthanol 2,2-ジフェニルエタノール
|
Physical Properties |
Melting Point: 55 ºC
Boiling Point: 160-162 ºC
(5 mmHg) |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Alcohols
|
Here you have an access to the other substances |
|
3,4-dihydropyrimido[4,5-b]quinoline-2(1H)-thione |
2-(1-pyrrolidinyl)bicyclo[3.3.1]nonan-9-one (6335-43-9) |
4-cyclooctene-1-carboxylic acid (4103-10-0) |
ethyl 3-octyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinecarboxylate |
2-methyl-6-phenyl-1,2,3,4,6,7,8,8a-octahydro-6-isoquinolinol |
ethyl 1-methyl-4-oxo-3-(3-oxobutyl)-3-piperidinecarboxylate |
1-chloro-4,5-dimethyl-2-(2-nitrophenoxy)benzene |
2-isopropyl-3-methylbutanamide (5440-65-3) |
2-isopropyl-3-methylbutanoic acid (32118-53-9) |
2-ethyl-2-methylbutanal |
2,4,6-cycloheptatrien-1-one (539-80-0) |
2-phenyldiazenyl-benzenesulfinic acid |
5-amino-1-benzyl-1H-1,2,3-triazole-4-carboxamide (4342-08-9) |
(6-amino-5-phenyldiazenyl-pyrimidin-4-yl)-amine (54288-02-7) |
ethyl (4Z)-4-[(3-chloro-2-methylphenyl)hydrazono]pentanoate |
6-methoxy-2,9,10,10a-tetrahydro-1H-phenanthren-3-one |
tert-butyl 2-hydroxy-2,2-diphenylacetate |
2,2,3,3,4,4,4-heptafluorobutanethioamide |
1-fluoro-4-nitrobenzene (350-46-9) |
2-Fluoro-5-nitrobenzotrifluoride (400-74-8) |
(4-fluorophenyl)acetic acid (405-50-5) |
2-(4-chlorophenyl)-2-methyl-1,3-dithiolane (6302-91-6) |
1-methylisoquinoline (1721-93-3) |
(2-methyl-1-oxo-1,2,3,4-tetrahydro-2-phenanthrenyl)acetyl chloride |
2-acetonyl-2-methyl-3,4-dihydrophenanthren-1-one |
|
|