|
3-hydroxyphthalic acid |
Molecular Formula: |
C8H6O5 |
Molecular Weight: |
182.133 g/mol |
|
|
Registry Numbers |
Cas Number: 601-97-8 |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
MNUOZFHYBCRUOD-QIQUEDJNCL |
Smiles: |
OC(=O)C1=CC=CC(=C1C(O)=O)O |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 77, p. 5092, 1955 DOI: 10.1021/ja01624a042
|
|
|
Synonym Chemical Name(s) |
|
3-hydroxy-phthalic acid
3-hydroxyphthalsäure
acide 3-hydroxyphthalic
3-ヒドロキシフタル酸
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Carboxylic acids
Phenols
|
Here you have an access to the other substances |
|
N,N-dimethyl-3-(4-methylphenyl)-3-buten-1-amine |
7-(diethylaminomethyl)-6-hydroxyquinoline-5,8-dione |
ethanethioic acid S-sec-butyl ester |
5,6-dimethoxy-8-nitroquinoline (5333-02-8) |
Azelaic acid (123-99-9) |
ethyl 3,3-dimethyl-2-oxobutanoate (5333-74-4) |
N-mesityl-2,4,6-trimethylbenzamide |
N-mesitylbenzamide (4476-12-4) |
2,2-dimethyl-3-methylsulfonylpropanoic acid (5324-67-4) |
4,4-dimethyl-1,1-dioxothiolan-3-one (5324-60-7) |
1-chloro-4-(2-chloro-2-phenylethyl)benzene |
3-hydroxy-2-methoxycarbonylbenzoic acid |
3-Hydroxyphthalic anhydride (37418-88-5) |
N-(4-methylphenyl)acetamide (103-89-9) |
methylcyclohexane (108-87-2) |
2-[(E)-2-(4-dimethylaminophenyl)ethenyl]-6-methylpyran-4-one |
4,5,6,7-tetrachloro-1H-1,2,3-benzotriazole (2338-10-5) |
6-methyl-3-(4-methylphenyl)-3,4-dihydroquinazoline (840-59-5) |
3,4-dimethyl-1-naphthyl acetate |
1-chloroacetone (78-95-5) |
3-chloro-2-butanone (4091-39-8) |
2-chloro-1-(chloromethyl)-3,4-dimethoxybenzene (93983-14-3) |
4H-thiochromeno[4,3-d][1,2,3]thiadiazole 5,5-dioxide |
phenyl-thiophen-3-ylmethanone (6453-99-2) |
5-phenyl-5-thiophen-2-ylimidazolidine-2,4-dione (7772-37-4) |
|
|