3-(5-ethoxycarbonyl-4-methyl-1H-pyrrol-3-yl)-propionic acid |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C11H15NO4 |
||||
Molecular Weight: |
225.244 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
KMHVZRBJGLIWLN-NDKGDYFDCP |
||||
Smiles: |
CCOC(=O)C1=C(C)C(=C[NH]1)CCC(O)=O |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Journal of the American Chemical Society, 76, p. 5641, 1954 DOI: 10.1021/ja01651a012 |
|||||
Synonym Chemical Name(s) | |||||
|
3-[5-(ethoxycarbonyl)-4-methyl-1H-pyrrol-3-yl]propanoic acid |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Related compounds | |||||
Here you have an access to the other substances | |||||
|
N,N-dichloro-1-phenylethanamine | 1H-1,2,3-triazole-4-carboxylic acid (16681-70-2) | ethyl hydrogen sulfate (15066-87-2) | 1-ethynyl-3-isopropylbenzene | 10-methyl-3-nitro-10H-phenothiazine | 3-chloro-10-methyl-10H-phenothiazine | 7,8,9,10-tetrahydrobenzo[a]cycloocten-5(6H)-one (829-14-1) | 4-cyclopentyl-2,6-piperidinedione | 1H-indol-5-ol (1953-54-4) | 2-(benzyloxy)aniline (20012-63-9) | 5-Benzyloxygramine (1453-97-0) | (5Z)-5-(1-bromopropylidene)-2,4-imidazolidinedione | 3-chlorobenzoic acid (535-80-8) | nicotinamide (98-92-0) | ethyl 3-bromo-2-oxo-3-phenylpropanoate | 2-bromo-1-phenylethanone (70-11-1) | 4-oxo-O-phosphonohomoserine | 2-nitronaphthalene (581-89-5) | 7,7-dibromonorcarane (2415-79-4) | 2,3-bis(4-chlorophenyl)aziridine | 2-amino-1,2-diphenylethanone (3723-23-7) | 6-amino-1-butyl-3-ethylpyrimidine-2,4-dione | phenyl trifluoroacetic anhydride | (2-nitro-1-nitrosoethyl)benzene (3532-83-0) | N-(2-nitro-1-phenylethyl)hydroxylamine | |
|||||
