|
Chrysofluorene |
Molecular Formula: |
C17H12 |
Molecular Weight: |
216.282 g/mol |
|
|
Registry Numbers |
Cas Number: 238-84-6 |
EINECS Number: n/a |
MDL Number: MFCD00039578 |
|
InChIKey: |
HKMTVMBEALTRRR-UHFFFAOYAQ |
Smiles: |
C1C2=C(C=CC=C2)C3=C1C4=C(C=CC=C4)C=C3 |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 73, p. 3439, 1951 DOI: 10.1021/ja01151a130 |
|
|
Synonym Chemical Name(s) |
|
1,2-Benzofluorene alpha-Naphthofluorene 11H-benzo[a]fluorene 11H-benzo[a]fluoren 11H-benzo[a]fluorène 11H-ベンゾ[a]フルオレン
|
Physical Properties |
Melting Point: 189 ºC
Boiling Point: 398 ºC |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Naphthalenes Fluorenes
|
Here you have an access to the other substances |
|
9-oxo-9H-fluorene-1-sulfonyl chloride |
1-morpholin-4-ylsulfanyl-fluoren-9-one |
9-oxo-9H-fluorene-1-sulfenyl chloride |
1-iodoacetone (3019-04-3) |
4-methyl-1,3-thiazolidin-2-amine |
ethyl 3-ethyl-5-methyl-2-oxotetrahydro-2H-pyran-3-carboxylate |
(3E)-3-chloro-3-hexene |
Granatonine (552-70-5) |
3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde O-methyloxime |
1-ethoxy-4-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-yl acetate |
8-methyl-11H-benzo[a]fluorene-5,11-diol |
8-methyl-11H-benzo[a]fluoren-5-ol |
6-thiabicyclo[3.1.0]hexane (285-75-6) |
1,2-Cyclohexylene sulfide (286-28-2) |
naphtho[2,3-d][1,3]dithiole-2,4,9-trione |
ethyl 2-phenylmethoxycarbonylaminoacetate (1145-81-9) |
4-methyl-2-pyrimidinamine (108-52-1) |
4a-methyl-2,3,4,9,10,10a-hexahydro-phenanthren-1-one |
(2E)-2-(hydroxyimino)-N-[3-(trifluoromethyl)phenyl]ethanamide |
2-propylsulfanyl-propane (5008-73-1) |
1,5-dibromo-2-methylpentane (25118-31-4) |
2,3,4,5,6-pentamethylbenzoyl chloride |
2-dimethylaminoethyl 2-hydroxy-4-nitrobenzoate |
4-nitro-2-phenylmethoxybenzoic acid (5340-21-6) |
diethyl 4-oxo-4H-quinolizine-1,3-dicarboxylate (54401-76-2) |
|
|