|
1-benzylnaphthalene |
Molecular Formula: |
C17H14 |
Molecular Weight: |
218.298 g/mol |
|
|
Registry Numbers |
Cas Number: 611-45-0 |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
KTHUKEZOIFYPEH-UHFFFAOYAD |
Smiles: |
C(C1=CC=CC=C1)C2=CC=CC3=C2C=CC=C3 |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 69, p. 1254, 1947 DOI: 10.1021/ja01198a007 |
|
|
Synonym Chemical Name(s) |
|
1-benzyl-naphthalene 1-(phenylmethyl)naphthalene 1-benzylnaphthalin 1-benzylnaphthalène 1-ベンジルナフタレン
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Naphthalenes
|
Here you have an access to the other substances |
|
1-chloro-4-vinylbenzene (1073-67-2) |
ethyl (2Z)-2-(hydroxyimino)hexanoate |
N-[5-(4-nitrophenyl)diazenylthiophen-2-yl]acetamide |
diethyl 2-allyl-2-(cyclobutylmethyl)malonate |
3-(4-methylphenyl)-3-oxopropanenitrile (7391-28-8) |
butyl 2,2-dibutylhexanoate |
1-bromo-3,3,3-trichloropropyl acetate |
3-cyclohexyl-N-methyl-2-butanamine |
(5,7-dimethyl-1,8-naphthyridin-2-yl)amine (39565-07-6) |
2,3-diphenyl-1H-pyrrolo[2,3-b]pyridin-6-ylamine (55463-74-6) |
4-ethoxybenzenesulfonyl chloride (1132-17-8) |
1-chloro-1-methyl-2-nitrosocyclopentane |
6-dimethylamino-hexan-2-one |
5-bromo-N-isopropyl-1-hexanamine |
N-(thiophen-2-yl-methyl)-hydroxylamine (73941-31-8) |
(2E)-2-(isopropoxymethylene)octahydro-1(2H)-naphthalenone |
8a-methyl-2,3,4,4a,5,6,7,8-octahydro-naphthalen-1-one |
Orotic acid (65-86-1) |
(2,5-dioxo-4-imidazolidinyl)acetic acid (5427-26-9) |
acenaphthylene (208-96-8) |
2-aminoethanesulfonamide (4378-70-5) |
3-phenyl-5,6-dihydro-2H-1,2,4-thiadiazine 1,1-dioxide |
4-imino-3-piperidinecarbonitrile (20373-91-5) |
4-oxo-3-piperidinecarbonitrile (19166-75-7) |
1-nitro-2-(2-thiocyanatocyclohexyl)sulfanylbenzene |
|
|