|
acenaphthylene |
Molecular Formula: |
C12H8 |
Molecular Weight: |
152.196 g/mol |
|
|
Registry Numbers |
Cas Number: 208-96-8 |
EINECS Number: 205-917-1 |
MDL Number: MFCD00003806 |
|
InChIKey: |
HXGDTGSAIMULJN-UHFFFAOYAQ |
Smiles: |
C1=CC2=C3C(=C1)C=CC3=CC=C2 |
 |
Synthesis Reference |
|
Journal of the American Chemical Society, 69, p. 1388, 1947 DOI: 10.1021/ja01198a044
The Journal of Organic Chemistry, 61, p. 324, 1996 DOI: 10.1021/jo951613a
|
|
|
Synonym Chemical Name(s) |
|
acenaphthylen
acenaphtylène
アセナフチルエン
|
Physical Properties |
Melting Point: 89-92 ºC
Boiling Point: 265-275 ºC |
Density: 0.899 g/mL
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
 Naphthalenes
|
Here you have an access to the other substances |
|
(5,7-dimethyl-1,8-naphthyridin-2-yl)amine (39565-07-6) |
2,3-diphenyl-1H-pyrrolo[2,3-b]pyridin-6-ylamine (55463-74-6) |
4-ethoxybenzenesulfonyl chloride (1132-17-8) |
1-chloro-1-methyl-2-nitrosocyclopentane |
1-benzylnaphthalene (611-45-0) |
6-dimethylamino-hexan-2-one |
5-bromo-N-isopropyl-1-hexanamine |
N-(thiophen-2-yl-methyl)-hydroxylamine (73941-31-8) |
(2E)-2-(isopropoxymethylene)octahydro-1(2H)-naphthalenone |
8a-methyl-2,3,4,4a,5,6,7,8-octahydro-naphthalen-1-one |
Orotic acid (65-86-1) |
(2,5-dioxo-4-imidazolidinyl)acetic acid (5427-26-9) |
2-aminoethanesulfonamide (4378-70-5) |
3-phenyl-5,6-dihydro-2H-1,2,4-thiadiazine 1,1-dioxide |
4-imino-3-piperidinecarbonitrile (20373-91-5) |
4-oxo-3-piperidinecarbonitrile (19166-75-7) |
1-nitro-2-(2-thiocyanatocyclohexyl)sulfanylbenzene |
2,5-diphenethyl-1,4-dihydro-pyrazine |
(Z)-4-(carboxymethylamino)-4-oxobut-2-enoic acid |
2-succinimidoacetic acid methyl ester |
2-ethylsulfinylsulfanyl-2-methylpropane |
2-ethyldisulfanyl-2-methylpropane (102107-90-4) |
2-(dimethylamino)-1-methyl-2-oxoethyl acetate (6280-18-8) |
2-hydroxy-N,N-dimethylpropanamide (35123-06-9) |
N,N-dimethylacrylamide (2680-03-7) |
|
|