|
dibenzo[a,e]cyclooctene-5,12-dicarbonitrile |
Molecular Formula: |
C18H10N2 |
Molecular Weight: |
254.291 g/mol |
|
|
Registry Numbers |
Cas Number: n/a |
EINECS Number: n/a |
MDL Number: n/a |
|
InChIKey: |
XUXPFMIRYBVWGQ-FXBDWADEBQ |
Smiles: |
N#CC/1=C/C2=C(C=CC=C2)\C=C(C#N)/C3=C1C=CC=C3 |
![Chemical structure of dibenzo[a,e]cyclooctene-5,12-dicarbonitrile](/molimg/1/big/9/9178.gif) |
Synthesis Reference |
|
Journal of the American Chemical Society, 68, p. 2577, 1946 DOI: 10.1021/ja01216a046 |
|
|
Physical Properties |
Melting Point: n/a
Boiling Point: n/a |
Density: n/a
Refractive Index: n/a |
|
H1 NMR Spectrum: |
Predict NMR spectrum |
MSDS: |
coming soon |
Related compounds |
|
Nitriles
|
Here you have an access to the other substances |
|
methyl 3-oxotetrahydro-2-thiophenecarboxylate (2689-69-2) |
methyl (4Z)-4-benzylidene-3-oxotetrahydro-2-thiophenecarboxylate |
dinitro-methyl-benzene (611-38-1) |
2,3-dimethylbutanal (2109-98-0) |
5-bromo-6-(ethoxymethyl)-2-methyl-4-pyrimidinol |
4-(4-cyclohexyloxy-cyclohexyl)-butyric acid |
4-(4-phenoxyphenyl)butanoic acid (6958-94-7) |
4-oxo-4-(4-phenoxyphenyl)butanoic acid (36330-86-6) |
3-fluoro-2-hydroxybenzaldehyde (394-50-3) |
4-isothiocyanatobenzenesulfonamide (51908-29-3) |
(E)-2-(2,4-dimethylphenyl)ethenylphosphonic acid |
ethyl 3-bromo-4-hydroxy-2-quinolinecarboxylate |
4,7-dichloro-6-quinolinesulfonyl chloride |
phenyl-thiophen-2-ylmethanone (135-00-2) |
6-methoxy-N-phenylquinoline-5,8-diimine |
6-methoxy-N-phenylquinoline-5,8-diamine |
7-chloro-2,4-quinolinedicarboxylic acid |
7-quinolinecarboxylic acid (1078-30-4) |
butyl 4-hydroxy-3-methoxybenzenecarboximidoate |
4-hydroxy-3-methoxybenzamide |
3-(3-vinyl-4-piperidinyl)propanoic acid |
ethyl 3-(3-vinyl-4-piperidinyl)propanoate |
8-(1-piperidinylmethyl)-7-quinolinol |
8-methyl-7-quinolinol |
7-isoquinolinol (7651-83-4) |
|
|