(3E)-3-(1,3-benzodioxol-5-yl)-4-(phenylsulfanyl)-3-buten-2-one |
|||||
|---|---|---|---|---|---|
Molecular Formula: |
C17H14O3S |
||||
Molecular Weight: |
298.362 g/mol |
||||
Registry Numbers |
|||||
|
|||||
InChIKey: |
IUNAONQQVUNOLS-GDNBJRDFBY |
||||
Smiles: |
CC(=O)C(=C/SC1=CC=CC=C1)/C2=CC3=C(OCO3)C=C2 |
||||
![]() |
|||||
Synthesis Reference | |||||
|
Journal of the American Chemical Society, 102, p. 2838, 1980 DOI: 10.1021/ja00528a054 |
|||||
Synonym Chemical Name(s) | |||||
|
(E)-3-(1,3-benzodioxol-5-yl)-4-phenylsulfanylbut-3-en-2-one |
|||||
Physical Properties |
|||||
|
|||||
H1 NMR Spectrum: |
|||||
MSDS: |
coming soon |
||||
Here you have an access to the other substances | |||||
|
2,5-dichloroaniline (95-82-9) | 2,2,5-trimethyl-4-cyclohepten-1-one (19822-67-4) | octanal (124-13-0) | 4-methoxyaniline (104-94-9) | N,N'-ditert-butyl-1-phenylethane-1,2-diamine | (1,4,8-trimethyl-3,7-cycloundecadien-1-yl)methanol | ethyl 2,4,6-triisopropylbenzoate (63846-76-4) | 2-allyl-3-methylnaphthoquinone | 2-(hydroxy-phenylmethyl)-2-methylcyclohexan-1-one (132646-01-6) | tert-butyl hexanoate | 2,2-diphenyloxirane (882-59-7) | butyl butyrate (109-21-7) | 2-methyl-1H-indole (95-20-5) | 2-cyclohexen-1-amine | [4-(3-hydroxybutyl)phenyl](phenyl)methanone | (2-butyl-2-methylcyclopropyl)benzene | (2E)-2-methyl-2,6-heptadienoic acid | methyl (2E,4E)-2-methyl-2,4-nonadienoate | 3-butyl-2-methyl-2-cyclohexen-1-one | 1-tetradecyne (765-10-6) | methyl (2E)-3-methyl-2-heptenoate | 2-(tert-butylamino)-1-phenylethanol | bicyclo[8.2.2]tetradeca-1(12),5,10,13-tetraene-4-carbonitrile | 1-amino-3-hexanone | 1,4-Benzoquinone dimethyl diacetal (15791-03-4) | |
|||||
